|
|
| | Sieboldin Basic information |
| Product Name: | Sieboldin | | Synonyms: | Sieboldin;Phloretin-3-hydroxy-4-O-glucoside;3-Hydroxyphloretin-4′-glucoside;1-Propanone, 3-(3,4-dihydroxyphenyl)-1-[4-(β-D-glucopyranosyloxy)-2,6-dihydroxyphenyl]-;Sieboldin USP/EP/BP;3-(3,4-Dihydroxyphenyl)-1-[4-(β-D-glucopyranosyloxy)-2,6-dihydroxyphenyl]-1-propanone;Epoxiconazolet Impurity 3 | | CAS: | 18777-73-6 | | MF: | C21H24O11 | | MW: | 452.41 | | EINECS: | | | Product Categories: | | | Mol File: | 18777-73-6.mol |  |
| | Sieboldin Chemical Properties |
| Boiling point | 832.5±65.0 °C(Predicted) | | density | 1.621±0.06 g/cm3(Predicted) | | pka | 6.84±0.40(Predicted) | | InChIKey | XJHMLSKQZFKMLL-LKLLPNDVNA-N | | SMILES | C(C1C(=CC(O[C@H]2[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O2)O)=CC=1O)O)(=O)CCC1C=CC(O)=C(O)C=1 |&1:6,7,8,10,12,r| |
| | Sieboldin Usage And Synthesis |
| Uses | Sieboldin is a dihydrochalcone, which inhibits the production of advanced glycation end products (AGE) produced by bovine serum albumins (BSA), has free radical scavenging activity and cytotoxicity in cancer cell lines, and is also used to capture of methylglyoxal (MGO) from Malus baccata[1]. | | References | [1] Kim J H, et al. Trapping of Methylglyoxal by Sieboldin from Malus baccata L. and Identification of Sieboldin-Methylglyoxal Adducts Forms[J]. Natural Product Sciences, 2021, 27(4): 245-250. |
| | Sieboldin Preparation Products And Raw materials |
|