| Company Name: |
Hongdebiotech Gold |
| Tel: |
18951116523 17712623939 |
| Email: |
dma@handesciences.com |
2,2,14,14-tetramethyl-8-oxopentadecanedioic acid manufacturers
|
| | 2,2,14,14-tetramethyl-8-oxopentadecanedioic acid Basic information |
| Product Name: | 2,2,14,14-tetramethyl-8-oxopentadecanedioic acid | | Synonyms: | 2,2,14,14-tetramethyl-8-oxopentadecanedioic acid;8-oxo-2,2,14,14-tetramethylpentadecanedioicacid;ETC-1002 Impurity 4;Bempedoic Acid Impurity 1;Pentadecanedioic acid, 2,2,14,14-tetramethyl-8-oxo-;Bempedoic acid Impurity 5;2,2,14,14-tetramethyl-8-oxopentadecanedioic acidQ: What is
2,2,14,14-tetramethyl-8-oxopentadecanedioic acid Q: What is the CAS Number of
2,2,14,14-tetramethyl-8-oxopentadecanedioic acid Q: What is the storage condition of
2,2,14,14-tetramethyl-8-oxopentadecanedioic acid;2,2,14,14-tetramethyl-8-oxopentadecanedioic acid（Bempedoic Acid Impurity 1） | | CAS: | 413624-71-2 | | MF: | C19H34O5 | | MW: | 342.47 | | EINECS: | | | Product Categories: | | | Mol File: | 413624-71-2.mol |  |
| | 2,2,14,14-tetramethyl-8-oxopentadecanedioic acid Chemical Properties |
| Melting point | 82-83 °C | | Boiling point | 524.0±35.0 °C(Predicted) | | density | 1.042±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | form | Solid | | pka | 4.54±0.45(Predicted) | | color | White to off-white | | InChI | InChI=1S/C19H34O5/c1-18(2,16(21)22)13-9-5-7-11-15(20)12-8-6-10-14-19(3,4)17(23)24/h5-14H2,1-4H3,(H,21,22)(H,23,24) | | InChIKey | NHVXRVOYVVPVDU-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(C)(C)CCCCCC(=O)CCCCCC(C)(C)C(O)=O |
| | 2,2,14,14-tetramethyl-8-oxopentadecanedioic acid Usage And Synthesis |
| Uses | 2,2,14,14-Tetramethyl-8-oxopentadecanedioic Acid favorably alter lipid disorders in relation to obesity. |
| | 2,2,14,14-tetramethyl-8-oxopentadecanedioic acid Preparation Products And Raw materials |
|