|
|
| | (R)-tert-butyl 3-methyl-5-oxopiperidine-1-carboxylate Basic information |
| Product Name: | (R)-tert-butyl 3-methyl-5-oxopiperidine-1-carboxylate | | Synonyms: | (R)-tert-butyl 3-methyl-5-oxopiperidine-1-carboxylate;1-Piperidinecarboxylic acid, 3-methyl-5-oxo-, 1,1-dimethylethyl ester, (3R)-;tert-butyl 3-methyl-5-oxopiperidine-1-carboxylate;tert-butyl (3R)-3-methyl-5-oxopiperidine-1-carboxylate;tert-butyl (R)-3-methyl-5-oxopiperidine-1-carboxylate;(R)-3-Methyl-5-oxo-piperidine-1-carboxylic acid tert-butyl ester;1,1-Dimethylethyl (3R)-3-methyl-5-oxo-1-piperidinecarboxylate;(R)-1-Boc-5-methylpiperidin-3-one | | CAS: | 1601475-90-4 | | MF: | C11H19NO3 | | MW: | 213.27 | | EINECS: | | | Product Categories: | | | Mol File: | 1601475-90-4.mol |  |
| | (R)-tert-butyl 3-methyl-5-oxopiperidine-1-carboxylate Chemical Properties |
| Boiling point | 298.8±33.0 °C(Predicted) | | density | 1.060±0.06 g/cm3(Predicted) | | storage temp. | -20°C, sealed storage, away from moisture | | pka | -1.67±0.40(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C11H19NO3/c1-8-5-9(13)7-12(6-8)10(14)15-11(2,3)4/h8H,5-7H2,1-4H3/t8-/m1/s1 | | InChIKey | PIXOEWQIZRMJQU-MRVPVSSYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CC(=O)C[C@@H](C)C1 |
| | (R)-tert-butyl 3-methyl-5-oxopiperidine-1-carboxylate Usage And Synthesis |
| Uses | (3R)-3-Methyl-4-oxo-1-piperidinecarboxylic Acid 1,1-Dimethyl Ester is a reactant in the synthesis of novel inhibitors of HDM2-p53 protein-protein interactions. |
| | (R)-tert-butyl 3-methyl-5-oxopiperidine-1-carboxylate Preparation Products And Raw materials |
|