- Bis(4-bromophenyl)ether
-
- $45.00 / 1KG
-
2026-05-15
- CAS:2050-47-7
- Min. Order: 1KG
- Purity: 98%+
- Supply Ability: 300MT/year
|
| | Bis(4-bromophenyl) ether Basic information |
| | Bis(4-bromophenyl) ether Chemical Properties |
| Melting point | 61-63 °C(lit.) | | Boiling point | 338-340 °C(lit.) | | density | 1.6728 (rough estimate) | | refractive index | 1.6260 (estimate) | | Fp | 338-340°C | | storage temp. | 2-8°C | | solubility | Methanol (Slightly) | | form | Crystalline | | color | White | | Water Solubility | Soluble in water. | | Henry's Law Constant | 8.3×10-2 mol/(m3Pa) at 25℃, Lau et al. (2006) | | InChI | InChI=1S/C12H8Br2O/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-8H | | InChIKey | YAWIAFUBXXPJMQ-UHFFFAOYSA-N | | SMILES | O(C1=CC=C(Br)C=C1)C1=CC=C(Br)C=C1 | | CAS DataBase Reference | 2050-47-7(CAS DataBase Reference) | | NIST Chemistry Reference | 4-Bromophenyl ether(2050-47-7) | | EPA Substance Registry System | p,p'-Dibromodiphenyl ether (2050-47-7) |
| Hazard Codes | F,Xn,N | | Risk Statements | 33-67-65-50/53-38-11 | | Safety Statements | 24/25-62-61-60-33-29-16-9 | | RIDADR | UN 1262 3/PG 2 | | WGK Germany | 3 | | RTECS | KN0175000 | | TSCA | Yes | | HS Code | 29093090 | | Storage Class | 11 - Combustible Solids | | Toxicity | LD50 ipr-mus: 125 mg/kg NTIS** AD277-689 |
| | Bis(4-bromophenyl) ether Usage And Synthesis |
| Chemical Properties | Tan or light crystalline | | Uses | PBDE 15 is a polybrominated di-Ph ether (PBDE), which is a flame retardant often incorporated into many polymers. PBDEs are an environmental pollutant that exhibit potential health risks to humans and wildlife. | | Safety Profile | Poison by intraperitoneal route. When heated todecomposition it emits toxic fumes of Br-. | | Synthesis | The general procedure for the synthesis of 4,4'-dibromodiphenyl ether from diphenyl ether was as follows: in a four-necked round-bottomed flask fitted with a stirrer, condenser, dropping funnel and thermometer, diphenyl ether (170 g, 1.0 mol), 1,2-dichloroethane (EDC) (300 ml), water (200 ml) and NaBrO3 (55 g, 0.36 mol) were added. Bromine (176 g, 1.1 mol) was slowly added dropwise to the stirred mixture for 1 h at 25 °C. No significant HBr gas was released during the reaction. The reaction progress was monitored by gas chromatography (GC). After two hours of reaction, the diphenyl ether was completely converted to 4,4'-dibromodiphenyl ether. The reaction was stopped and the phases were separated to give the crude product 4,4'-dibromodiphenyl ether (324.8 g) in 99% yield and 99.5% selectivity. | | References | [1] Patent: EP429975, 1991, A1
[2] Angewandte Chemie - International Edition, 2018, vol. 57, # 20, p. 5938 - 5942
[3] Angew. Chem., 2018, vol. 130, p. 6044 - 6049,6
[4] Monatshefte fuer Chemie, 1992, vol. 123, # 12, p. 1153 - 1162 |
| | Bis(4-bromophenyl) ether Preparation Products And Raw materials |
|