|
|
| | 9H-Xanthen-9-one, 3-bromo-
Basic information |
| Product Name: | 9H-Xanthen-9-one, 3-bromo-
| | Synonyms: | 9H-Xanthen-9-one, 3-bromo-;3-bromoxanthenon;3-bromo -9H- xanthene-9-one;3-Bromo-10H-dibenzo[b,e]pyran-10-one;3-Bromoxanthenone;3-bromo-9H-xanthen-9-one | | CAS: | 500286-36-2 | | MF: | C13H7BrO2 | | MW: | 275.1 | | EINECS: | | | Product Categories: | | | Mol File: | 500286-36-2.mol |  |
| | 9H-Xanthen-9-one, 3-bromo-
Chemical Properties |
| Boiling point | 403.2±34.0 °C(Predicted) | | density | 1.620±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | Appearance | White to off-white Solid | | InChI | InChI=1S/C13H7BrO2/c14-8-5-6-10-12(7-8)16-11-4-2-1-3-9(11)13(10)15/h1-7H | | InChIKey | UEKROUJUENOVKW-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=CC=C2)OC2=C1C=CC(Br)=C2 |
| | 9H-Xanthen-9-one, 3-bromo-
Usage And Synthesis |
| | 9H-Xanthen-9-one, 3-bromo-
Preparation Products And Raw materials |
|