- Norfloxacin? Nicotinic
-
- $0.00 / 25Kg/Drum
-
2026-02-13
- CAS:118803-81-9
- Min. Order: 1KG
- Purity: 99%min
- Supply Ability: 1000kg
- Norfloxacin Nicotinic
-
- $150.00 / 1kg
-
2025-05-23
- CAS:118803-81-9
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 500kg
|
| | QUINOLINE-3-CARBOXYLIC ACID Basic information |
| Product Name: | QUINOLINE-3-CARBOXYLIC ACID | | Synonyms: | RARECHEM AL BO 1256;AKOS BBS-00005333;3-quinolinecarboxylicacid,1,4-dihydro-1-ethyl-6-fluoro-4-oxo-7-(1-piperazinyl;mono-3-pyridinecarboxylate;3-Quinolinecarboxylic acid, 1,4-dihydro-1-ethyl-6-fluoro-4-oxo-7-(1-piperazinyl)-, mono-3-pyridinecarboxylate;3-Quinolinecarboxylic acid, 1-ethyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-, mono-3-pyridinecarboxylate;3-Pyridinecarboxylic acid mono[1-ethyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylate];Nicotinic acid Norfloxacin Injection | | CAS: | 118803-81-9 | | MF: | C10H7NO2 | | MW: | 173.17 | | EINECS: | 229-337-3 | | Product Categories: | | | Mol File: | 118803-81-9.mol |  |
| | QUINOLINE-3-CARBOXYLIC ACID Chemical Properties |
| Melting point | 277-280 °C(lit.) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | DMSO (Slightly), Water (Slightly) | | form | White to yellow crystalline solid. | | InChI | InChI=1S/C16H18FN3O3.C6H5NO2/c1-2-19-9-11(16(22)23)15(21)10-7-12(17)14(8-13(10)19)20-5-3-18-4-6-20;8-6(9)5-2-1-3-7-4-5/h7-9,18H,2-6H2,1H3,(H,22,23);1-4H,(H,8,9) | | InChIKey | WRIFLTAYLRDENF-UHFFFAOYSA-N | | SMILES | C12C=C(C(F)=CC=1C(=O)C(C(=O)O)=CN2CC)N1CCNCC1.C1(C(=O)O)=CN=CC=C1 |
| | QUINOLINE-3-CARBOXYLIC ACID Usage And Synthesis |
| Uses | Norfloxacin nicotinate is a fluoroquinolone antibacterial agent that is a norfloxacin derivative with improved solubility in water. | | in vivo | Norfloxacin nicotinate (5 and/or 25 mg/L) significantly induces antioxidant enzymes activities and the mRNA levels of genes related to antioxidant enzymes and innate immune system in zebrafish larvae[1]. | | IC 50 | Quinolone |
| | QUINOLINE-3-CARBOXYLIC ACID Preparation Products And Raw materials |
|