| Company Name: |
SuZhou ShiYa Biopharmaceuticals, Inc.
|
| Tel: |
0512-0512-52358471 17715136450 |
| Email: |
sales@shiyabiopharm.com |
| Products Intro: |
Product Name:(4-Chloro-3-nitro-phenyl)-carbamic acid tert-butyl ester
CAS:503524-47-8
Purity:95% Package:1g;5g;10g;25g Remarks:A1-1487
|
| Company Name: |
Changzhou Kechem Bio-Scientific Co., LTD.
|
| Tel: |
0519-68985668 13685222090 |
| Email: |
sales@kechem.cn |
| Products Intro: |
Product Name:tert-Butyl N-(4-chloro-3-nitrophenyl)carbamate
CAS:503524-47-8
Purity:0.97 Package:g；kg
|
| Company Name: |
Shanghai Haohong Pharmaceutical Co., Ltd.
|
| Tel: |
400-8210725 4008210725 |
| Email: |
malulu@leyan.com |
| Products Intro: |
Product Name:tert-Butyl (4-chloro-3-nitrophenyl)carbamate
CAS:503524-47-8
Purity:98%
|
|
| | tert-butyl 4-chloro-3-nitrophenylcarbamate Basic information |
| Product Name: | tert-butyl 4-chloro-3-nitrophenylcarbamate | | Synonyms: | tert-butyl 4-chloro-3-nitrophenylcarbamate;(4-Chloro-3-nitro-phenyl)-carbamic acid tert-butyl ester;tert-Butyl N-(4-chloro-3-nitrophenyl)carbamate;Carbamic acid, N-(4-chloro-3-nitrophenyl)-, 1,1-dimethylethyl ester | | CAS: | 503524-47-8 | | MF: | C11H13ClN2O4 | | MW: | 272.68 | | EINECS: | | | Product Categories: | | | Mol File: | 503524-47-8.mol |  |
| | tert-butyl 4-chloro-3-nitrophenylcarbamate Chemical Properties |
| Melting point | 107-108 °C | | Boiling point | 324.1±32.0 °C(Predicted) | | density | 1.348±0.06 g/cm3(Predicted) | | pka | 12.07±0.70(Predicted) |
| | tert-butyl 4-chloro-3-nitrophenylcarbamate Usage And Synthesis |
| | tert-butyl 4-chloro-3-nitrophenylcarbamate Preparation Products And Raw materials |
|