|
|
| | tert-butyl 4-(2-(hydroxymethyl)phenyl)piperidine-1-carboxylate Basic information |
| Product Name: | tert-butyl 4-(2-(hydroxymethyl)phenyl)piperidine-1-carboxylate | | Synonyms: | tert-butyl 4-(2-(hydroxymethyl)phenyl)piperidine-1-carboxylate;1-Piperidinecarboxylic acid, 4-[2-(hydroxymethyl)phenyl]-, 1,1-dimethylethyl ester;tert-Butyl 4-(2-(hydroxymethyl)phenyl)piperidine-1-carboxylate;2-(1-Boc-piperidin-4-yl)phenyl]methanol;tert-butyl 4-[2-(hydroxymethyl)phenyl]piperidine-1-carboxylate - [B85957] | | CAS: | 255051-62-8 | | MF: | C17H25NO3 | | MW: | 291.39 | | EINECS: | | | Product Categories: | | | Mol File: | 255051-62-8.mol |  |
| | tert-butyl 4-(2-(hydroxymethyl)phenyl)piperidine-1-carboxylate Chemical Properties |
| Boiling point | 420.8±40.0 °C(Predicted) | | density | 1.109±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 14.32±0.10(Predicted) | | form | powder | | SMILES | O=C(N(CC1)CCC1C2=C(CO)C=CC=C2)OC(C)(C)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Eye Irrit. 2
Skin Irrit. 2
Skin Sens. 1 |
| | tert-butyl 4-(2-(hydroxymethyl)phenyl)piperidine-1-carboxylate Usage And Synthesis |
| Uses | tert-Butyl 4-(2-(hydroxymethyl)phenyl)piperidine-1-carboxylate is a 4-aryl piperidine useful as a semi-flexible linker in PROTAC development for targeted protein degradation. Incorporation of rigidity into the linker region of bifunctional protein degraders may impact the 3D orientation of the degrader and thus ternary complex formation as well as optimization of drug-like properties. | | reaction suitability | reagent type: linker |
| | tert-butyl 4-(2-(hydroxymethyl)phenyl)piperidine-1-carboxylate Preparation Products And Raw materials |
|