|
|
| | 1-Methyl-1H-imidazole-4-carboxylic acid Basic information | | Application |
| | 1-Methyl-1H-imidazole-4-carboxylic acid Chemical Properties |
| Melting point | 245 °C | | Boiling point | 399.1±15.0 °C(Predicted) | | density | 1.34±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO, Methanol | | form | Solid | | pka | 1.61±0.10(Predicted) | | color | Off-White to Light Brown | | Sensitive | Hygroscopic | | InChI | InChI=1S/C5H6N2O2/c1-7-2-4(5(8)9)6-3-7/h2-3H,1H3,(H,8,9) | | InChIKey | WZTRQGJMMHMFGH-UHFFFAOYSA-N | | SMILES | C1N(C)C=C(C(O)=O)N=1 | | CAS DataBase Reference | 41716-18-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1-Methyl-1H-imidazole-4-carboxylic acid Usage And Synthesis |
| Application | 1-Methyl-4-imidazolium carboxylic acid belongs to the imidazolium derivative class. It has certain acidity and is mainly used as an intermediate in organic synthesis and pharmaceutical chemistry. It can be used in the synthesis of bioactive molecules and biological hormones. | | Chemical Properties | White to light brown solid | | Definition | ChEBI: 1-methyl-imidazole-4-carboxylic acid is an imidazolyl carboxylic acid. It has a role as a metabolite. |
| | 1-Methyl-1H-imidazole-4-carboxylic acid Preparation Products And Raw materials |
|