| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
Clomipramine D3 Hydrochloride manufacturers
|
| | Clomipramine D3 Hydrochloride Basic information |
| Product Name: | Clomipramine D3 Hydrochloride | | Synonyms: | Clomipramine D3 Hydrochloride;Clomipramine-d;Clomipramine-d3 Hydrochloride (N-methyl-d3);Clomipramine D3 HydrochlorideQ: What is
Clomipramine D3 Hydrochloride Q: What is the CAS Number of
Clomipramine D3 Hydrochloride Q: What is the storage condition of
Clomipramine D3 Hydrochloride Q: What are the applications of
Clomipramine D3 Hydrochloride;Clomipramine-d3 hydrochloride solution;Clomipramine-D3 Hydrochloride 0.1 mg/ml in Methanol (as free base);Clomipramine-D3.HCl, 0.1mg/ml in Methanol (as free base);Clomipramine-D3.HCl, 1mg/ml in Methanol (as free base) | | CAS: | 1398065-86-5 | | MF: | C19H24Cl2N2 | | MW: | 351.32 | | EINECS: | | | Product Categories: | | | Mol File: | 1398065-86-5.mol |  |
| | Clomipramine D3 Hydrochloride Chemical Properties |
| Fp | 9℃ | | storage temp. | -20°C | | solubility | DMF: 3 mg/ml,DMSO: 10 mg/ml,Ethanol: 10 mg/ml,PBS (pH 7.2): 0.5 mg/ml | | form | A crystalline solid | | color | White to off-white | | Major Application | clinical testing | | InChI | 1S/C19H23ClN2.ClH/c1-21(2)12-5-13-22-18-7-4-3-6-15(18)8-9-16-10-11-17(20)14-19(16)22;/h3-4,6-7,10-11,14H,5,8-9,12-13H2,1-2H3;1H/i1D3; | | InChIKey | WIMWMKZEIBHDTH-NIIDSAIPSA-N | | SMILES | Clc1cc2c(cc1)CCc3c(cccc3)N2CCCN(C([2H])([2H])[2H])C.Cl |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | Clomipramine D3 Hydrochloride Usage And Synthesis |
| Uses | Labeled Clomipramine, intended for use as an internal standard for the quantification of Clomipramine by GC- or LC-mass spectrometry. | | General Description | Clomipramine is a tricyclic antidepressant used to many conditions from major depression and panic disorder to narcolepsy and obsessive compulsion disorder (OCD). This internal standard is is suitable for quantitation of Clomipramine levels in urine, serum, or plasma by LC/MS or GC/MS for applications in clinical toxicology, forensic analysis, isotope dilution methods, or pharmaceutical research. |
| | Clomipramine D3 Hydrochloride Preparation Products And Raw materials |
|