|
| Methyl 4-piperidineacetate Basic information |
| Methyl 4-piperidineacetate Chemical Properties |
Boiling point | 145 °C(Press: 0.2 Torr) | density | 0.982±0.06 g/cm3(Predicted) | storage temp. | 2-8°C(protect from light) | form | solid | pka | 10.40±0.10(Predicted) | Appearance | Colorless to light yellow Liquid | InChI | InChI=1S/C8H15NO2/c1-11-8(10)6-7-2-4-9-5-3-7/h7,9H,2-6H2,1H3 | InChIKey | VOUIHMBRJVKANW-UHFFFAOYSA-N | SMILES | N1CCC(CC(OC)=O)CC1 | CAS DataBase Reference | 168986-49-0(CAS DataBase Reference) |
| Methyl 4-piperidineacetate Usage And Synthesis |
Chemical Properties | Yellow to off-white solid |
| Methyl 4-piperidineacetate Preparation Products And Raw materials |
|