|
|
| | 2-Chlorodiphenyl-2',3',4',5',6'-d5 Basic information |
| Product Name: | 2-Chlorodiphenyl-2',3',4',5',6'-d5 | | Synonyms: | 2-chlorobiphenyl d5;pcb no.1 d5;2-CHLORODIPHENYL-2',3',4',5',6'-D5, 98 &;2-Chlorobiphenyl-2',3',4',5',6'-d5;2′-Chlorodiphenyl-2,3,4,5,6-d5;PCB No. 1 D5 100 μg/mL in Isooctane;2-Chlorobiphenyl-2',3',4',5',6'-d5;2-Chlorodiphenyl-2',3',4',5',6'-d5 | | CAS: | 51624-35-2 | | MF: | C12H4ClD5 | | MW: | 193.68 | | EINECS: | | | Product Categories: | Alphabetical Listings;C;Stable Isotopes | | Mol File: | 51624-35-2.mol |  |
| | 2-Chlorodiphenyl-2',3',4',5',6'-d5 Chemical Properties |
| Melting point | 32 °C(lit.) | | Boiling point | 274.000±9.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.132±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | form | solid | | InChI | 1S/C12H9Cl/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H/i1D,2D,3D,6D,7D | | InChIKey | LAXBNTIAOJWAOP-FSTBWYLISA-N | | SMILES | [2H]c1c([2H])c([2H])c(c([2H])c1[2H])-c2ccccc2Cl |
| Hazard Codes | N | | Risk Statements | 33-50/53 | | Safety Statements | 35-60-61 | | RIDADR | UN 3432 9/PG 2 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 STOT RE 2 |
| | 2-Chlorodiphenyl-2',3',4',5',6'-d5 Usage And Synthesis |
| Uses | 2-Chlorobiphenyl-2'',3'',4'',5'',6''-d5 (CAS# 51624-35-2) is a useful isotopically labeled research compound. |
| | 2-Chlorodiphenyl-2',3',4',5',6'-d5 Preparation Products And Raw materials |
|