| Company Name: |
DebyeTec.com Inc. |
| Tel: |
18086626237 18086626237 |
| Email: |
2693528373@qq.com |
|
| | 1‐ethylcyclopropan‐1‐amine hydrochloride Basic information |
| Product Name: | 1‐ethylcyclopropan‐1‐amine hydrochloride | | Synonyms: | 1‐ethylcyclopropan‐1‐amine hydrochloride;1-ETHYLCYCLOPROPAN-1-AMINE HCL;1-Ethylcyclopropanamine hydrochloride;Cyclopropanamine,1-ethyl-,hydrochloride(1:1);1-ethylcyclopropanamine;1-Ethylcyclopropanamine HCl | | CAS: | 174886-06-7 | | MF: | C5H12ClN | | MW: | 121.61 | | EINECS: | | | Product Categories: | | | Mol File: | 174886-06-7.mol |  |
| | 1‐ethylcyclopropan‐1‐amine hydrochloride Chemical Properties |
| storage temp. | Store at 0-8 °C | | Appearance | white solid | | InChI | InChI=1S/C5H11N.ClH/c1-2-5(6)3-4-5;/h2-4,6H2,1H3;1H | | InChIKey | ZNYVZBCRYLJGFR-UHFFFAOYSA-N | | SMILES | C(C1(CC1)N)C.Cl |
| | 1‐ethylcyclopropan‐1‐amine hydrochloride Usage And Synthesis |
| | 1‐ethylcyclopropan‐1‐amine hydrochloride Preparation Products And Raw materials |
|