|
|
| | 1-(1,1-Dimethylethyl) (2S,4R)-4-fluoro-1,2-pyrrolidinedicarboxylate Basic information |
| Product Name: | 1-(1,1-Dimethylethyl) (2S,4R)-4-fluoro-1,2-pyrrolidinedicarboxylate | | Synonyms: | N-BOC-(4S,2R)-4-FLUORO-2-PYRROLIDINECARBOXYLIC ACID;N-BOC-TRANS-4-FLUORO-L-PROLINE;N-(TERT-BUTOXYCARBONYL)-(2S,4R)-4-FLUOROPROLINE;BOC-TRANS-4-FLUORO-L-PROLINE;(2S,4R)-N-Boc-trans-4-Fluoro-L-Proline;(2S,4R)-4-Fluoropyrrolidine-2-carboxylic acid, N4-BOC protected;trans-4-Fluoro-L-proline, N-BOC protected;(2S,4R)-Boc-4-fluoro-pyrrolidine-2-carboxylic acid | | CAS: | 203866-14-2 | | MF: | C10H16FNO4 | | MW: | 233.24 | | EINECS: | | | Product Categories: | Carboxylic Acids (Chiral);Chiral Building Blocks;Synthetic Organic Chemistry;Chiral Building Blocks;Heterocyclic Building Blocks;Pyrrolidines | | Mol File: | 203866-14-2.mol |  |
| | 1-(1,1-Dimethylethyl) (2S,4R)-4-fluoro-1,2-pyrrolidinedicarboxylate Chemical Properties |
| Melting point | 115-119°C | | Boiling point | 346.0±42.0 °C(Predicted) | | density | 1.24±0.1 g/cm3(Predicted) | | refractive index | -69 ° (C=1, MeOH) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Methanol | | pka | 3.53±0.40(Predicted) | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | [α]22/D -65.0±5°, c = 1 in chloroform | | InChI | InChI=1S/C10H16FNO4/c1-10(2,3)16-9(15)12-5-6(11)4-7(12)8(13)14/h6-7H,4-5H2,1-3H3,(H,13,14)/t6-,7+/m1/s1 | | InChIKey | YGWZXQOYEBWUTH-RQJHMYQMSA-N | | SMILES | N1(C(OC(C)(C)C)=O)C[C@H](F)C[C@H]1C(O)=O | | CAS DataBase Reference | 203866-14-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1-(1,1-Dimethylethyl) (2S,4R)-4-fluoro-1,2-pyrrolidinedicarboxylate Usage And Synthesis |
| Chemical Properties | White powder | | Uses | N-Boc-trans-4-fluoro-L-proline is a useful synthetic intermediate. It is used to prepare potent 3- or 4-substituted-2-cyanopyrrolidine dipeptidyl peptidase IV inhibitors. It is also used to synthesize pyrrolotriazines derivatives as pan-Aurora kinase inhibitors and anti-tumor agents. |
| | 1-(1,1-Dimethylethyl) (2S,4R)-4-fluoro-1,2-pyrrolidinedicarboxylate Preparation Products And Raw materials |
|