| Company Name: |
Shijiazhuang yaoBo Pharmaceutical Co., Ltd. Gold
|
| Tel: |
15633056635 |
| Email: |
2880679888@qq.com |
| Products Intro: |
Product Name:Cinepazide Impurity D
CAS:1227926-25-1
Purity:95%+ Package:25mg;50mg;100mg Remarks:1000mg
|
| Company Name: |
ChemStrong Scientific Co.,Ltd
|
| Tel: |
0755-66853366 13670046396 |
| Email: |
sales@chem-strong.com |
| Products Intro: |
Product Name:Cinepazide Impurity C
CAS:1227926-25-1
Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Shanghai Kewel Chemical Co., Ltd.
|
| Tel: |
021-64609169 18901607656 |
| Email: |
greensnown@163.com |
| Products Intro: |
Product Name:Cinepazide Impurity C
CAS:1227926-25-1
Purity:95+ HPLC; Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Roark Standards
|
| Tel: |
0755-83552066 15986688328 |
| Email: |
service@roarkstandards.com |
| Products Intro: |
Product Name:Cinepazide N-Oxide
CAS:1227926-25-1
Purity:98% HPLC Package:10MG;25MG;50MG;100MG
|
|
| | Cinepazide N-Oxide Basic information |
| Product Name: | Cinepazide N-Oxide | | Synonyms: | Cinepazide Impurity D;(E)-1-(2-oxo-2-(pyrrolidin-1-yl)ethyl)-4-(3-(3,4,5-trimethoxyphenyl)acryloyl);Cinepazide Impurity 4/Cinepazide N-Oxide;Cinepazide Impurity;2-Propen-1-one, 1-[4-oxido-4-[2-oxo-2-(1-pyrrolidinyl)ethyl]-1-piperazinyl]-3-(3,4,5-trimethoxyphenyl)-;Cinepazide Impurities1386;Cinepazide Impurities2;Cinepazide Impurity 1 | | CAS: | 1227926-25-1 | | MF: | C22H31N3O6 | | MW: | 433.5 | | EINECS: | | | Product Categories: | | | Mol File: | 1227926-25-1.mol |  |
| | Cinepazide N-Oxide Chemical Properties |
| InChI | InChI=1S/C22H31N3O6/c1-29-18-14-17(15-19(30-2)22(18)31-3)6-7-20(26)24-10-12-25(28,13-11-24)16-21(27)23-8-4-5-9-23/h6-7,14-15H,4-5,8-13,16H2,1-3H3 | | InChIKey | AAUSFTUVUYYFTD-UHFFFAOYSA-N | | SMILES | C(N1CC[N+]([O-])(CC(=O)N2CCCC2)CC1)(=O)C=CC1=CC(OC)=C(OC)C(OC)=C1 |
| | Cinepazide N-Oxide Usage And Synthesis |
| | Cinepazide N-Oxide Preparation Products And Raw materials |
|