- 3-phenylnaphthalen-1-ol
-
- $200.00 / 1KG
-
2025-09-25
- CAS:30069-65-9
- Min. Order: 1KG
- Purity: 99%, 99.5% Sublimated
- Supply Ability: g-kg-tons, free sample is available
- 3-phenylnaphthalen-1-ol
-
- $0.00 / 1KG
-
2025-07-02
- CAS:30069-65-9
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 150KG /month
|
| | 3-phenylnaphthalen-1-ol Basic information |
| | 3-phenylnaphthalen-1-ol Chemical Properties |
| Melting point | 96-97.5 °C(Solv: chloroform (67-66-3); hexane (110-54-3)) | | Boiling point | 417.4±24.0 °C(Predicted) | | density | 1.176±0.06 g/cm3(Predicted) | | storage temp. | RT, stored under nitrogen | | pka | 9.28±0.40(Predicted) | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C16H12O/c17-16-11-14(12-6-2-1-3-7-12)10-13-8-4-5-9-15(13)16/h1-11,17H | | InChIKey | MAPYOCUYNJWAJW-UHFFFAOYSA-N | | SMILES | C1(O)=C2C(C=CC=C2)=CC(C2=CC=CC=C2)=C1 |
| | 3-phenylnaphthalen-1-ol Usage And Synthesis |
| Uses |
3-phenylnaphthalen-1-ol is used as chemical reagents, fine chemicals and the intermediates of electronic chemical materials.
| | Hazard |
3-phenylnaphthalen-1-ol is harmful if swallowed, it causes skin irritation and serious eye irritation.
|
| | 3-phenylnaphthalen-1-ol Preparation Products And Raw materials |
|