|
|
| | Dodecafluoroheptyl methacrylate Basic information |
| Product Name: | Dodecafluoroheptyl methacrylate | | Synonyms: | 2,3,4,5,5,5-hexafluoro-2,4-bis(trifluoromethyl)pentyl methacrylate;2-Propenoic acid, 2-methyl-, 2,3,4,5,5,5-hexafluoro-2,4-bis(trifluoromethyl)pentyl ester;Methyl1H,1H,2H,2H-perfluorooctylacrylate | | CAS: | 45285-78-7 | | MF: | C11H8F12O2 | | MW: | 400.16 | | EINECS: | | | Product Categories: | | | Mol File: | 45285-78-7.mol |  |
| | Dodecafluoroheptyl methacrylate Chemical Properties |
| Boiling point | 194.4±40.0 °C(Predicted) | | density | 1.457±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C11H8F12O2/c1-4(2)5(24)25-3-7(13,9(15,16)17)6(12)8(14,10(18,19)20)11(21,22)23/h6H,1,3H2,2H3 | | InChIKey | FAQPSTUYBXJPBF-UHFFFAOYSA-N | | SMILES | C(OCC(F)(C(F)(F)F)C(F)C(F)(C(F)(F)F)C(F)(F)F)(=O)C(C)=C |
| | Dodecafluoroheptyl methacrylate Usage And Synthesis |
| | Dodecafluoroheptyl methacrylate Preparation Products And Raw materials |
|