- ML364
-
- $66.00
-
2026-05-11
- CAS:1991986-30-1
- Purity: 99.92%
- Supply Ability: 10g
|
| Product Name: | ML364 | | Synonyms: | ML364;ML364, 1991986-30-1;ML 364;ML-364;ML364, >98%;Benzamide, 2-[[(4-methylphenyl)sulfonyl]amino]-N-(4-phenyl-2-thiazolyl)-4-(trifluoromethyl)-;ML364 >=98% (HPLC);2-((4-Methylphenyl)sulfonamido)-N-(4-phenylthiazol-2-yl)-4-(trifluoromethyl)benzamide;Deubiquitinase,Inhibitor,ML 364,DUBs,ML-364,ML364,inhibit | | CAS: | 1991986-30-1 | | MF: | C24H18F3N3O3S2 | | MW: | 517.54 | | EINECS: | | | Product Categories: | | | Mol File: | 1991986-30-1.mol |  |
| | ML364 Chemical Properties |
| density | 1.457±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; DMSO:PBS (pH 7.2) (1:2): 0.33 mg/ml; Ethanol: 20 mg/ml | | form | A crystalline solid | | pka | 6.51±0.50(Predicted) | | color | Light yellow to yellow | | InChIKey | QZUGMNXETPARLI-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1cc(c(cc1)C(=O)Nc3[s]cc(n3)c4ccccc4)N[S](=O)(=O)c2ccc(cc2)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | ML364 Usage And Synthesis |
| Uses | ML364 is a small molecular inhibitor of the deubiquitinase USP2, which accelerates cyclin D1 degrdation and leads to cell cycle arrest in colorectal cancer and mantle cell lymphoma. | | Biological Activity | ML364 is a potent and specific inhibitor of the deubiquitinase USP2 th at induces cellular Cyclin D1 degradation in HCT116 colorectal cancer cells, followed by cell cycle arrest and apoptosis. Also, ML364 inhibits homologous recombination (HR)-mediated DNA repair. |
| | ML364 Preparation Products And Raw materials |
|