| Company Name: |
Shanghai TuZhi Chemical Co., Ltd.
|
| Tel: |
19542790274 13166475250; |
| Email: |
2119559397@qq.com |
| Products Intro: |
Product Name:Methyl 5-Bromo-2-Methyl-2H-1,2,3-triazole-4-carboxylate
CAS:1372711-70-0
Purity:97% Package:1g;10g;100g
|
|
| | Methyl 5-Bromo-2-Methyl-2H-1,2,3-triazole-4-carboxylate Basic information |
| | Methyl 5-Bromo-2-Methyl-2H-1,2,3-triazole-4-carboxylate Chemical Properties |
| Boiling point | 300.4±45.0 °C(Predicted) | | density | 1.84±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, sealed storage, away from moisture | | pka | -3.46±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C5H6BrN3O2/c1-9-7-3(4(6)8-9)5(10)11-2/h1-2H3 | | InChIKey | BSHWJBSHZPLXDB-UHFFFAOYSA-N | | SMILES | N1=C(Br)C(C(OC)=O)=NN1C |
| | Methyl 5-Bromo-2-Methyl-2H-1,2,3-triazole-4-carboxylate Usage And Synthesis |
| | Methyl 5-Bromo-2-Methyl-2H-1,2,3-triazole-4-carboxylate Preparation Products And Raw materials |
|