| Company Name: |
Wuhan HSN Pharmaresearch CO., LTD. Gold
|
| Tel: |
027-81525288 18086100502 |
| Email: |
linwell@126.com |
| Products Intro: |
Product Name:1-[4-Bromo-3-(bromomethyl)phenyl]ethanone
CAS:1844064-91-0
Purity:98% Package:1KG；25kg
|
| Company Name: |
Shanghai Kewel Chemical Co., Ltd.
|
| Tel: |
021-64609169 18901607656 |
| Email: |
greensnown@163.com |
| Products Intro: |
Product Name:Velpatasvir Impurity 22
CAS:1844064-91-0
Purity:95+ HPLC; Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Hubei Yangxin Medical Technology Co., Ltd.
|
| Tel: |
15374522761 |
| Email: |
3003392093@yongstandards.com |
| Products Intro: |
Product Name:Velpatasvir Impurity 22
CAS:1844064-91-0
Purity:99%+ HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Suzhou Rovathin Foreign Trade Co.,Ltd
|
| Tel: |
0512-65816829 18662214788 |
| Email: |
info@rovathin.com.cn |
| Products Intro: |
Product Name:1-[4-bromo-3-(bromomethyl)phenyl]Ethanone
CAS:1844064-91-0
Purity:0.95 Package:1g;10g;100g;1kg
|
|
| | 1-[4-Bromo-3-(bromomethyl)phenyl]ethanone Basic information |
| | 1-[4-Bromo-3-(bromomethyl)phenyl]ethanone Chemical Properties |
| Boiling point | 356.7±37.0 °C(Predicted) | | density | 1.752±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C9H8Br2O/c1-6(12)7-2-3-9(11)8(4-7)5-10/h2-4H,5H2,1H3 | | InChIKey | MZBSTXFRZOCIMJ-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(Br)C(CBr)=C1)C |
| | 1-[4-Bromo-3-(bromomethyl)phenyl]ethanone Usage And Synthesis |
| | 1-[4-Bromo-3-(bromomethyl)phenyl]ethanone Preparation Products And Raw materials |
|