- 3,7-Diethylnonane-4,6-dione
-
- $15.00 / 1KG
-
2021-07-02
- CAS:872802-98-7
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 3,7-Diethylnonane-4,6-dione Basic information | | Uses |
| Product Name: | 3,7-Diethylnonane-4,6-dione | | Synonyms: | 3,7-Diethylnonane-4,6-dione;4,6-Nonanedione, 3,7-diethyl-;3,7-Diethyl-4,6-nonanedione;3, 7-diethyl-4, 6-diketone | | CAS: | 872802-98-7 | | MF: | C13H24O2 | | MW: | 212.33 | | EINECS: | | | Product Categories: | OLED | | Mol File: | 872802-98-7.mol |  |
| | 3,7-Diethylnonane-4,6-dione Chemical Properties |
| Boiling point | 111-113 °C(Press: 10 Torr) | | density | 0.891±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 10.15±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C13H24O2/c1-5-10(6-2)12(14)9-13(15)11(7-3)8-4/h10-11H,5-9H2,1-4H3 | | InChIKey | MFELLNQJMHCAKI-UHFFFAOYSA-N | | SMILES | CCC(CC)C(=O)CC(=O)C(CC)CC |
| | 3,7-Diethylnonane-4,6-dione Usage And Synthesis |
| Uses | 3,7-Diethylnonane-4,6-dione can be used as OLED intermediate. | | Description | 3,7-Diethylnonane-4,6-dione is a ketone compound that can be used as a photovoltaic material for organic electroluminescent materials and devices. | | Chemical Properties | colorless to light yellow transparent Liquid | | Reactions | 3,7-Diethylnonane-4,6-dione forms Hazardous decomposition products under fire conditions: carbonmonoxide. | | Hazard |
3,7-Diethylnonane-4,6-dione is harmful if swallowed.
|
| | 3,7-Diethylnonane-4,6-dione Preparation Products And Raw materials |
|