| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | 2-Cyano-but-2-enoic acid Basic information |
| Product Name: | 2-Cyano-but-2-enoic acid | | Synonyms: | 2-Cyano-but-2-enoic acid;2-Butenoic acid, 2-cyano-;(e)-2-cyanobut-2-enoic acid;2-Cyano-2-butenoic Acid | | CAS: | 759-72-8 | | MF: | C5H5NO2 | | MW: | 111.1 | | EINECS: | | | Product Categories: | | | Mol File: | 759-72-8.mol |  |
| | 2-Cyano-but-2-enoic acid Chemical Properties |
| Melting point | 97 °C | | Boiling point | 274.604±23.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.201±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Store at room temperature | | pka | 1.759±0.19(predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C5H5NO2/c1-2-4(3-6)5(7)8/h2H,1H3,(H,7,8) | | InChIKey | SAADORAEBXDJQA-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(C#N)=CC |
| | 2-Cyano-but-2-enoic acid Usage And Synthesis |
| Uses | 2-Cyano-2-butenoic acid is a reagent used in the preparation of pyrimidine and pyridine compounds which are used as BTK inhibitors. |
| | 2-Cyano-but-2-enoic acid Preparation Products And Raw materials |
|