| Company Name: |
Wuxi AppTec |
| Tel: |
022-59987777 13552403979 |
| Email: |
jia_guoqiang@wuxiapptec.com |
| Company Name: |
Labnetwork lnc. |
| Tel: |
+86-27-50766799 +86-18062016861 |
| Email: |
contact@labnetwork.com |
|
| | Tert-Butyl 4-Oxo-1-Oxa-8-Azaspiro[4.5]Decane-8-Carboxylate Basic information |
| Product Name: | Tert-Butyl 4-Oxo-1-Oxa-8-Azaspiro[4.5]Decane-8-Carboxylate | | Synonyms: | Tert-Butyl 4-Oxo-1-Oxa-8-Azaspiro[4.5]Decane-8-Carboxylate;Tert-Butyl 4-Oxo-1-Oxa-8-Azaspiro[4.5]Decane-8-Carboxylate(WX101840);1-Oxa-8-azaspiro[4.5]decane-8-carboxylic acid, 4-oxo-, 1,1-dimethylethyl ester;8-Boc-4-oxo-1-oxa-8-azaspiro[4.5]decane;tert-butyl 4-oxo-1-Oxa-8-azaspiro[4.5]decane-8-carboxylate - [B83716] | | CAS: | 1782622-45-0 | | MF: | C13H21NO4 | | MW: | 255.31 | | EINECS: | | | Product Categories: | | | Mol File: | 1782622-45-0.mol | ![Tert-Butyl 4-Oxo-1-Oxa-8-Azaspiro[4.5]Decane-8-Carboxylate Structure](CAS/20180527/GIF/1782622-45-0.gif) |
| | Tert-Butyl 4-Oxo-1-Oxa-8-Azaspiro[4.5]Decane-8-Carboxylate Chemical Properties |
| Boiling point | 375.5±42.0 °C(Predicted) | | density | 1.16±0.1 g/cm3(Predicted) | | pka | -0.90±0.20(Predicted) | | InChI | InChI=1S/C13H21NO4/c1-12(2,3)18-11(16)14-7-5-13(6-8-14)10(15)4-9-17-13/h4-9H2,1-3H3 | | InChIKey | DXERLBFKDLTNKK-UHFFFAOYSA-N | | SMILES | O1C2(CCN(C(OC(C)(C)C)=O)CC2)C(=O)CC1 |
| | Tert-Butyl 4-Oxo-1-Oxa-8-Azaspiro[4.5]Decane-8-Carboxylate Usage And Synthesis |
| | Tert-Butyl 4-Oxo-1-Oxa-8-Azaspiro[4.5]Decane-8-Carboxylate Preparation Products And Raw materials |
|