|
|
| | 3-Benzyloxy-4-methoxybenzaldehyde Basic information |
| | 3-Benzyloxy-4-methoxybenzaldehyde Chemical Properties |
| Melting point | 61-64 °C (lit.) | | Boiling point | 120 °C / 5mmHg | | density | 1.1515 (rough estimate) | | refractive index | 1.5570 (estimate) | | storage temp. | Inert atmosphere,2-8°C | | solubility | Dichloromethane, Ethyl Acetate, Methanol | | form | Solid | | color | Pale Yellow | | Sensitive | Air Sensitive | | BRN | 794627 | | InChI | InChI=1S/C15H14O3/c1-17-14-8-7-13(10-16)9-15(14)18-11-12-5-3-2-4-6-12/h2-10H,11H2,1H3 | | InChIKey | VQVQZFHUXRSRBZ-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(OC)C(OCC2=CC=CC=C2)=C1 | | CAS DataBase Reference | 6346-05-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29124990 | | Storage Class | 11 - Combustible Solids |
| | 3-Benzyloxy-4-methoxybenzaldehyde Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | 3-Benzyloxy-4-methoxybenzaldehyde was used in the synthesis of (+)-9-benzyloxy-α-dihydrotetrabenazine. It was also used in total synthesis of (-)-galipeine. |
| | 3-Benzyloxy-4-methoxybenzaldehyde Preparation Products And Raw materials |
|