| Company Name: |
Suzhou Haiben Pharmaceutical Co., Ltd
|
| Tel: |
19353112242 |
| Email: |
1816280386@qq.com |
| Products Intro: |
Product Name:Phosphonic acid, (1-methylethyl)-, mono(4-ethyl-1-hexyloctyl) ester CAS:130816-17-0 Purity:98% HPLC Package:10g;100g;1kg;10kg
|
| Company Name: |
Taizhou Chuanxu Pharmaceutical Technology Co., Ltd.
|
| Tel: |
13000000000 |
| Email: |
974144639@qq.com |
| Products Intro: |
Product Name:Phosphonic acid, (1-methylethyl)-, mono(4-ethyl-1-hexyloctyl) ester CAS:130816-17-0 Purity:98.5% HPLC Package:10g;100g;1kg;10kg
|
|
| | Phosphonic acid, (1-methylethyl)-, mono(4-ethyl-1-hexyloctyl) ester Basic information |
| | Phosphonic acid, (1-methylethyl)-, mono(4-ethyl-1-hexyloctyl) ester Chemical Properties |
| InChI | InChI=1S/C19H41O3P/c1-6-9-11-12-14-19(22-23(20,21)17(4)5)16-15-18(8-3)13-10-7-2/h17-19H,6-16H2,1-5H3,(H,20,21) | | InChIKey | MNMSYECOBFEVOW-UHFFFAOYSA-N | | SMILES | C(P(O)(OC(CCCCCC)CCC(CC)CCCC)=O)(C)C |
| | Phosphonic acid, (1-methylethyl)-, mono(4-ethyl-1-hexyloctyl) ester Usage And Synthesis |
| | Phosphonic acid, (1-methylethyl)-, mono(4-ethyl-1-hexyloctyl) ester Preparation Products And Raw materials |
|