|
|
| | Benzenamine, 2,4,6-trimethyl-N-(2,4,6-trimethylphenyl)- Basic information |
| Product Name: | Benzenamine, 2,4,6-trimethyl-N-(2,4,6-trimethylphenyl)- | | Synonyms: | Benzenamine, 2,4,6-trimethyl-N-(2,4,6-trimethylphenyl)-;Dimesitylamine | | CAS: | 6050-18-6 | | MF: | C18H23N | | MW: | 253.38 | | EINECS: | | | Product Categories: | | | Mol File: | 6050-18-6.mol |  |
| | Benzenamine, 2,4,6-trimethyl-N-(2,4,6-trimethylphenyl)- Chemical Properties |
| Melting point | 124 °C | | Boiling point | 365.2±11.0 °C(Predicted) | | density | 1.001±0.06 g/cm3(Predicted) | | pka | 1.18±0.50(Predicted) | | InChI | InChI=1S/C18H23N/c1-11-7-13(3)17(14(4)8-11)19-18-15(5)9-12(2)10-16(18)6/h7-10,19H,1-6H3 | | InChIKey | HSXWOKPAUZMPML-UHFFFAOYSA-N | | SMILES | C1(NC2=C(C)C=C(C)C=C2C)=C(C)C=C(C)C=C1C |
| | Benzenamine, 2,4,6-trimethyl-N-(2,4,6-trimethylphenyl)- Usage And Synthesis |
| | Benzenamine, 2,4,6-trimethyl-N-(2,4,6-trimethylphenyl)- Preparation Products And Raw materials |
|