2-Propanol, 1,1-difluoro- manufacturers
- 2-Propanol11-difluoro-
-
- $1.00 / 1KG
-
2025-12-12
- CAS:431-04-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10000KG
|
| | 2-Propanol, 1,1-difluoro- Basic information |
| Product Name: | 2-Propanol, 1,1-difluoro- | | Synonyms: | 2-Propanol, 1,1-difluoro-;1,1-DIFLUOROPROPAN-2-OL;1, 1-difluoropropane-2-alcohol;1,1-Difluoro-2-propanol | | CAS: | 431-04-9 | | MF: | C3H6F2O | | MW: | 96.08 | | EINECS: | | | Product Categories: | | | Mol File: | 431-04-9.mol |  |
| | 2-Propanol, 1,1-difluoro- Chemical Properties |
| Boiling point | 93-93.5 °C | | density | 1.101±0.06 g/cm3(Predicted) | | pka | 13.07±0.20(Predicted) | | InChI | InChI=1S/C3H6F2O/c1-2(6)3(4)5/h2-3,6H,1H3 | | InChIKey | AKVKBTWZKYWPNV-UHFFFAOYSA-N | | SMILES | C(F)(F)C(O)C |
| | 2-Propanol, 1,1-difluoro- Usage And Synthesis |
| | 2-Propanol, 1,1-difluoro- Preparation Products And Raw materials |
|