| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Tris(4-trifluoromethylphenyl)phosphine Basic information |
| | Tris(4-trifluoromethylphenyl)phosphine Chemical Properties |
| Melting point | 70-75 °C | | Boiling point | 382.8±42.0 °C(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Liquid | | color | Clear | | Water Solubility | Insoluble in water. | | InChI | InChI=1S/C21H12F9P/c22-19(23,24)13-1-7-16(8-2-13)31(17-9-3-14(4-10-17)20(25,26)27)18-11-5-15(6-12-18)21(28,29)30/h1-12H | | InChIKey | PXYCJKZSCDFXLR-UHFFFAOYSA-N | | SMILES | P(C1=CC=C(C(F)(F)F)C=C1)(C1=CC=C(C(F)(F)F)C=C1)C1=CC=C(C(F)(F)F)C=C1 | | CAS DataBase Reference | 13406-29-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | TSCA | No | | HazardClass | IRRITANT | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Tris(4-trifluoromethylphenyl)phosphine Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | Tris[4-(trifluoromethyl)phenyl]phosphine is a raw material and intermediate used in organic synthesis, pharmaceuticals and agrochemicals. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: ligand | | Synthesis | GENERAL METHODS: Triphenylphosphine oxide or its sulfide (1 mmol), anhydrous hexane (1 mL) and 1c (1 mmol) were sequentially added to Schlenk tubes under nitrogen atmosphere protection. The reaction was carried out at room temperature for 10 min and the progress of the reaction was monitored by thin layer chromatography (TLC). Upon completion of the reaction, the reaction mixture was filtered through a silica gel pad and washed several times with ethyl acetate. Subsequently, the ethyl acetate was removed by evaporation and the residue was purified by fast column chromatography on silica gel, using pure cyclohexane as eluent, to afford the target product tris(4-trifluorotoluene)phosphine. The product yield was determined by gas chromatography (GC) without further purification. | | References | [1] Journal of Organic Chemistry, 2008, vol. 73, # 4, p. 1524 - 1531 [2] Russian Journal of General Chemistry, 2015, vol. 85, # 5, p. 1156 - 1160 [3] Zh. Obshch. Khim., [4] Advanced Synthesis and Catalysis, 2016, vol. 358, # 1, p. 26 - 29 |
| | Tris(4-trifluoromethylphenyl)phosphine Preparation Products And Raw materials |
|