|
|
| | MORPHINE-D6 Basic information |
| Product Name: | MORPHINE-D6 | | Synonyms: | Morphine-D6 solution;MORPHINE-D6;(4R,4aR,7S,7aR,12bS)-1,1,2-trideuterio-3-(trideuteriomethyl)-2,4,4a,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol;Morphine-d6 (1.0 mg/mL in Methanol);Morphine-D6 solution | | CAS: | 1334606-17-5 | | MF: | C17H13D6NO3 | | MW: | 291.38 | | EINECS: | 802-938-3 | | Product Categories: | Chiral Reagents;Intermediates & Fine Chemicals;Isotope Labelled Compounds;Pharmaceuticals | | Mol File: | Mol File |  |
| | MORPHINE-D6 Chemical Properties |
| Melting point | >235C (dec.) | | Boiling point | 476.247±45.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.444±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | Fp | 9℃ | | storage temp. | Controlled Substance, -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 9.479±0.40(predicted) | | color | White to Off-White | | Major Application | forensics and toxicology | | InChIKey | BQJCRHHNABKAKU-VVVKWITHSA-N | | SMILES | [2H]C1N([C@@H]2Cc3ccc(O)c4O[C@H]5[C@@H](O)C=C[C@@H]2[C@]5(c34)C1([2H])[2H])C([2H])([2H])[2H] |
| Hazard Codes | F,T | | Risk Statements | 11-23/24/25-39/23/24/25 | | Safety Statements | 7-16-36/37-45 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | MORPHINE-D6 Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Labelled Morphine (M652290). Principal alkaloid of opium.
This is a controlled substance (opiate). Analgesic (narcotic). | | General Description | This stable-labeled internal standard is suitable for quantiation of morphine levels in urine, serum, or plasma by LC/MS or GC/MS for urine drug testing, pain prescription monitoring, clinical toxicology, forensic analysis, or isotope dilution methods. Morphine is a very potent opiate analgesic drug used to relieve both acute and chronic severe pain. Sold under trade names including MS Contin, Kadian, Oramorph, and Roxanol, morphine is also a commonly abused recreational drug due to its widespread availability and high potential for addiction. |
| | MORPHINE-D6 Preparation Products And Raw materials |
|