N,N'-Bis(2,4,6-trimethoxyphenyl)oxalamide (BTMPO) manufacturers
|
| | N,N'-Bis(2,4,6-trimethoxyphenyl)oxalamide (BTMPO) Basic information |
| Product Name: | N,N'-Bis(2,4,6-trimethoxyphenyl)oxalamide (BTMPO) | | Synonyms: | N,N'-Bis(2,4,6-trimethoxyphenyl)oxalamide (BTMPO);N1,N2-bis(2,4,6-trimethoxyphenyl)oxalamide;N,N'-Bis(2,4,6-trimethoxyphenyl)oxalamide, 95%;185091;N,N'-bis(2,4,6-trimethoxyphenyl)oxamide;Ethanediamide, N1,N2-bis(2,4,6-trimethoxyphenyl)-;N,N'-bis(2,4,6-trimethoxyphenyl)ethanediamide;N1,N2-Bis(2,4,6-trimethoxyphenyl)ethanediamide | | CAS: | 957476-07-2 | | MF: | C20H24N2O8 | | MW: | 420.41 | | EINECS: | | | Product Categories: | | | Mol File: | 957476-07-2.mol |  |
| | N,N'-Bis(2,4,6-trimethoxyphenyl)oxalamide (BTMPO) Chemical Properties |
| density | 1.283±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | pka | 9.06±0.70(Predicted) | | form | powder | | Appearance | White to light brown Solid | | InChI | InChI=1S/C20H24N2O8/c1-25-11-7-13(27-3)17(14(8-11)28-4)21-19(23)20(24)22-18-15(29-5)9-12(26-2)10-16(18)30-6/h7-10H,1-6H3,(H,21,23)(H,22,24) | | InChIKey | NGVJMONAWAGMOA-UHFFFAOYSA-N | | SMILES | C(NC1=C(OC)C=C(OC)C=C1OC)(=O)C(NC1=C(OC)C=C(OC)C=C1OC)=O |
| WGK Germany | WGK 3 | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | N,N'-Bis(2,4,6-trimethoxyphenyl)oxalamide (BTMPO) Usage And Synthesis |
| Uses | BTMPO is a ligand for the copper-catalyzed coupling of aryl bromides and secondary amines. |
| | N,N'-Bis(2,4,6-trimethoxyphenyl)oxalamide (BTMPO) Preparation Products And Raw materials |
|