- ROC-325
-
- $30.00 / 2mg
-
2026-01-05
- CAS:1859141-26-6
- Min. Order:
- Purity: 99.68%
- Supply Ability: 10g
|
| | ROC-325 Basic information |
| Product Name: | ROC-325 | | Synonyms: | ROC-325;ROC325;ROC 325;9H-Thioxanthen-9-one, 1-[[2-[[2-[(7-chloro-4-quinolinyl)amino]ethyl]methylamino]ethyl]amino]-4-methyl-;1-((2-((2-((7-Chloroquinolin-4-yl)amino)ethyl)(methyl)amino)ethyl)amino)-4-methyl-9H-thioxanthen-9-one;Apoptosis,anticancer,inhibit,Autophagosomes,cathepsin-D,lysosomes,ROC 325,ROC-325,ROC325,oral,Autophagy,Inhibitor;ROC-325, 10 mM in DMSO;ROC-325 ，S8527 | | CAS: | 1859141-26-6 | | MF: | C28H27ClN4OS | | MW: | 503.06 | | EINECS: | | | Product Categories: | | | Mol File: | 1859141-26-6.mol |  |
| | ROC-325 Chemical Properties |
| Boiling point | 726.0±60.0 °C(Predicted) | | density | 1.344±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | Chloroform: 10 mg/ml; DMF: slightly soluble; DMSO: slightly soluble; Ethanol: slightly soluble | | pka | 8.36±0.50(Predicted) | | form | A solid | | color | Light yellow to orange | | InChIKey | HXUYKEGAEIYPKY-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=CC=C2)SC2=C1C(NCCN(CCNC1=C3C(=NC=C1)C=C(Cl)C=C3)C)=CC=C2C |
| | ROC-325 Usage And Synthesis |
| Uses | ROC 325, is a novel inhibitor of autophagy. It triggers an increase in cathepsin D (CTSD) levels. | | in vivo | Oral administration of ROC-325 (25 mg/kg, 40 mg/kg, 50 mg/kg,) to mice bearing 786-0 RCC xenografts is well tolerated, significantly more effective at inhibiting tumor progression than Hydroxychloroquine, and inhibits autophagy in vivo[1]. |
| | ROC-325 Preparation Products And Raw materials |
|