|
|
| | 2-(3-cyano-4,5,5-trimethyl-5H-furan-2-ylidene)malononitrile Basic information | | Uses |
| Product Name: | 2-(3-cyano-4,5,5-trimethyl-5H-furan-2-ylidene)malononitrile | | Synonyms: | 2-(3-cyano-4,5,5-trimethyl-5H-furan-2-ylidene)malononitrile;JACS-171082-32-9;2-(3-cyano-4,5,5-trimethylfuran-2-ylidene)propanedinitrile;IN1602, 2-(3-Cyano-4,5,5-trimethylfuran-2(5H)-ylidene)malononitrile;Propanedinitrile, (3-cyano-4,5,5-trimethyl-2(5H)-furanylidene)-;Propanedinitrile, 2-(3-cyano-4,5,5-trimethyl-2(5H)-furanylidene)-;[3-Cyano-4,5,5-trimethyl-2(5H)-furanylidene]malononitrile;2-(3-Cyano-4,5,5-trimethyl-2(5H)-furanylidene)propanedinitrile | | CAS: | 171082-32-9 | | MF: | C11H9N3O | | MW: | 199.21 | | EINECS: | | | Product Categories: | | | Mol File: | 171082-32-9.mol |  |
| | 2-(3-cyano-4,5,5-trimethyl-5H-furan-2-ylidene)malononitrile Chemical Properties |
| Melting point | 197.5 °C | | Boiling point | 256.8±40.0 °C(Predicted) | | density | 1.20±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | Appearance | Light yellow to light brown Solid | | InChI | InChI=1S/C11H9N3O/c1-7-9(6-14)10(8(4-12)5-13)15-11(7,2)3/h1-3H3 | | InChIKey | FLMBQNOAWLPZPJ-UHFFFAOYSA-N | | SMILES | C(#N)/C(=C1/C(C#N)=C(C)C(C)(C)O/1)/C#N |
| | 2-(3-cyano-4,5,5-trimethyl-5H-furan-2-ylidene)malononitrile Usage And Synthesis |
| Uses | 2-(3-cyano-4,5,5-trimethylfuran-2(5H)-methylene)malonitrile is used as an intermediate in organic synthesis and OLED/OPV materials. |
| | 2-(3-cyano-4,5,5-trimethyl-5H-furan-2-ylidene)malononitrile Preparation Products And Raw materials |
|