(S)-1-(4-(4-methylthiazol-5-yl)phenyl)ethanamine hydrochloride manufacturers
|
| | (S)-1-(4-(4-methylthiazol-5-yl)phenyl)ethanamine hydrochloride Basic information | | Uses |
| Product Name: | (S)-1-(4-(4-methylthiazol-5-yl)phenyl)ethanamine hydrochloride | | Synonyms: | (S)-1-(4-(4-methylthiazol-5-yl)phenyl)ethanamine hydrochloride;(S)-1-[4-(4-Methylthiazol-5-yl)phenyl]ethanamine HCl;(S)-1-(4-(4-methylthiazol-5-yl)phenyl)ethan-1-amine hydrogen chloride;(S)-1-(4-(4-methylthiazol-5-yl)phenyl)ethan-1-amine hydrochloride;α-methyl-4-(4-methyl-5-thiazolyl)- hydrochloride (1:1),;CPD101077-B HCl;(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethan-1-amine hydrochloride;(S)-1-(4-(4-Methylthiazo-5-yl)phenyl)ethyl-1-amine hydrochloride | | CAS: | 1948273-01-5 | | MF: | C12H15ClN2S | | MW: | 254.78 | | EINECS: | | | Product Categories: | | | Mol File: | 1948273-01-5.mol |  |
| | (S)-1-(4-(4-methylthiazol-5-yl)phenyl)ethanamine hydrochloride Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | Off-white to yellow Solid | | InChI | InChI=1/C12H14N2S.ClH/c1-8(13)10-3-5-11(6-4-10)12-9(2)14-7-15-12;/h3-8H,13H2,1-2H3;1H/t8-;/s3 | | InChIKey | CIJVVVNRJVUMNI-JNODIIHCNA-N | | SMILES | CC1N=CSC=1C1C=CC([C@@H](N)C)=CC=1.Cl |&1:10,r| |
| | (S)-1-(4-(4-methylthiazol-5-yl)phenyl)ethanamine hydrochloride Usage And Synthesis |
| Uses | (S)-1-(4-(4-methylthiazolyl-5-yl)phenyl)ethyl-1-amine hydrochloride is a chiral benzylamine compound. The benzylamine unit in its structure has high chemical reactivity and can undergo condensation reactions with carboxylic acid compounds to obtain corresponding amide derivatives, which can then be used to construct chiral molecular libraries, drug research and other organic synthesis applications. |
| | (S)-1-(4-(4-methylthiazol-5-yl)phenyl)ethanamine hydrochloride Preparation Products And Raw materials |
|