|
|
| | [1,1':4',1''-Terphenyl]-2',3,3'',5,5',5''-hexacarboxylic acid Basic information |
| Product Name: | [1,1':4',1''-Terphenyl]-2',3,3'',5,5',5''-hexacarboxylic acid | | Synonyms: | [1,1':4',1''-Terphenyl]-2',3,3'',5,5',5''-hexacarboxylic acid;Terphenyl]-2',3,3'',5,5',5''-hexacarboxylicacid(1542274-12-3);4-(3,5-dicarboxyphenyl)-[1,1'-biphenyl]-2,3',5,5'-tetracarboxylic acid;1,1':4',1''-Terphenyl]-2',3,3'',5,5',5''-hexacarboxylic acid;[1,1':4',1"-Terphenyl]-2',3,3",5,5',5"-hexacarboxylic acid;[1,1':4',1''-tribiphenyl]-2',3,3'',5,5',5''-hexacarboxylic acid;2',3,3'',5,5',5''-hexacarboxylic acid;2,5-Bis(3,5-dicarboxyphenyl)terephthalic acid | | CAS: | 1542274-12-3 | | MF: | C24H14O12 | | MW: | 494.36 | | EINECS: | | | Product Categories: | | | Mol File: | 1542274-12-3.mol | ![[1,1':4',1''-Terphenyl]-2',3,3'',5,5',5''-hexacarboxylic acid Structure](CAS/20180527/GIF/1542274-12-3.gif) |
| | [1,1':4',1''-Terphenyl]-2',3,3'',5,5',5''-hexacarboxylic acid Chemical Properties |
| Boiling point | 935.6±65.0 °C(Predicted) | | density | 1.674±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 2.65±0.10(Predicted) | | Appearance | Off-white to light yellow Solid | | InChIKey | WCMYVQOLWBUDDQ-UHFFFAOYSA-N | | SMILES | C1(C2=CC(C(O)=O)=C(C3=CC(C(O)=O)=CC(C(O)=O)=C3)C=C2C(O)=O)=CC(C(O)=O)=CC(C(O)=O)=C1 |
| | [1,1':4',1''-Terphenyl]-2',3,3'',5,5',5''-hexacarboxylic acid Usage And Synthesis |
| Uses | Used as a ligand in the synthesis of MOF materials. |
| | [1,1':4',1''-Terphenyl]-2',3,3'',5,5',5''-hexacarboxylic acid Preparation Products And Raw materials |
|