| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | m-dPEG(R)12-Lipoamide Basic information |
| Product Name: | m-dPEG(R)12-Lipoamide | | Synonyms: | m-dPEG(R)12-Lipoamide;m-dPEG-Lipoamide;12-Lipoamide;mPEG??-Lipoamide;Poly(oxy-1,2-ethanediyl), α-[2-[[5-(3R)-1,2-dithiolan-3-yl-1-oxopentyl]amino]ethyl]-ω-methoxy-;m-dPEG?12-Lipoamide;m-dPEG???-Lipoamide (QBD-10801);m-dPEG???-Lipoamide (QBD-10804) | | CAS: | 1334172-68-7 | | MF: | C33H65NO13S2 | | MW: | 747.9981 | | EINECS: | | | Product Categories: | | | Mol File: | 1334172-68-7.mol |  |
| | m-dPEG(R)12-Lipoamide Chemical Properties |
| storage temp. | -20°C | | form | solid or viscous liquid | | InChIKey | WHTUJGAYCNMFSV-UHFFFAOYSA-N | | SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCNC(CCCCC1CCSS1)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | m-dPEG(R)12-Lipoamide Usage And Synthesis |
| reaction suitability | reagent type: chemical modification reagent reagent type: cross-linking reagent reactivity: gold reactive |
| | m-dPEG(R)12-Lipoamide Preparation Products And Raw materials |
|