|
|
| | 4-Bromo-3,5-dimethylisoxazole Basic information |
| Product Name: | 4-Bromo-3,5-dimethylisoxazole | | Synonyms: | BUTTPARK 33\06-98;4-BROMO-3,5-DIMETHYLISOXAZOLE;4-BROMO-3,5-DIMETHYLISOXAZOLE 97%;Isoxazole, 4-broMo-3,5-diMethyl-;4-Bromo-3,5-dimethylisoxazole, tech.;4-Bromo-3,5-dimethylisoxazole,97%;4-Bromo-3,5-dimethylisoxa...;TIMTEC-BB SBB003784 | | CAS: | 10558-25-5 | | MF: | C5H6BrNO | | MW: | 176.01 | | EINECS: | 000-000-0 | | Product Categories: | Halogenated Heterocycles;Heterocyclic Building Blocks;Isoxazoles;IsoxazolesBuilding Blocks;Oxazole&Isoxazole;blocks;Bromides;Oxazoles | | Mol File: | 10558-25-5.mol |  |
| | 4-Bromo-3,5-dimethylisoxazole Chemical Properties |
| Boiling point | 176 °C(lit.) | | density | 1.478 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.486(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | pka | -2.35±0.28(Predicted) | | form | clear liquid | | color | Colorless to Light orange to Yellow | | Sensitive | Light Sensitive | | BRN | 108522 | | InChI | InChI=1S/C5H6BrNO/c1-3-5(6)4(2)8-7-3/h1-2H3 | | InChIKey | GYHZPSUAMYIFQD-UHFFFAOYSA-N | | SMILES | O1C(C)=C(Br)C(C)=N1 | | CAS DataBase Reference | 10558-25-5(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | Hazard Note | Keep Cold/Light Sensitive | | HS Code | 29349990 | | Storage Class | 10 - Combustible liquids |
| | 4-Bromo-3,5-dimethylisoxazole Usage And Synthesis |
| Chemical Properties | clear colorless to light yellow liquid | | Uses | 4-Bromo-3,5-dimethylisoxazole may be used in the preparation of (tert-butyldimethylsilyl)-(3,5-dimethylisoxazol-4-yl)phenylamine and 3,3′,5,5′-tetramethyl-4,4′-diisoxazole.[21} | | General Description | 4-Bromo-3,5-dimethylisoxazole is also known as 3,5-dimethyl-4-bromoisoxazole. | | Synthesis | The general procedure for the synthesis of 4-bromo-3,5-dimethylisoxazole from 3,5-dimethylisoxazole is as follows:
1. Preparation of intermediate 105 (4-bromo-3,5-dimethyl-1,2-oxazole): DMF (53 mL) was added to a 250 mL round-bottomed flask fitted with a magnetic stirrer.
2. 3,5-dimethyl-1,2-oxazole (5.3 g, 54.57 mmol) and N-iodosuccinimide (11.659 g, 65.49 mmol) were sequentially added to the stirred DMF.
3. After completion of the addition, the reaction mixture was heated to 75°C and maintained for 3 hours.
4. Upon completion of the reaction, the mixture was diluted with ethyl acetate (100 mL).
5. The organic layer was washed sequentially with saturated NaHCO3 solution (100 mL), sodium thiosulfate solution (100 mL), water (200 mL) and brine (100 mL).
6. The organic layer was dried over anhydrous Na2SO4 and then concentrated under reduced pressure to remove the solvent to afford the target product 4-bromo-3,5-dimethyl-1,2-oxazole (6.1 g, 63.4% yield). | | References | [1] Patent: WO2012/11125, 2012, A1. Location in patent: Page/Page column 148; 149 [2] Rend. Ist. lomb., 1936, vol. 69, p. 587,600 |
| | 4-Bromo-3,5-dimethylisoxazole Preparation Products And Raw materials |
|