- 2,3-DIFLUOROETHOXYBENZENE
-
- $0.00 / 1kg
-
2025-12-29
- CAS:121219-07-6
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: According to customer requirements
- 2,3-DIFLUOROETHOXYBENZENE
-
- $100.00 / 1KG
-
2025-09-25
- CAS:121219-07-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 2,3-DIFLUOROETHOXYBENZENE Basic information |
| Product Name: | 2,3-DIFLUOROETHOXYBENZENE | | Synonyms: | 2,3-DIFLUORO-4-ETHOXYBENZENE;2,3-DIFLUOROETHOXYBENZENE;1-ETHOXY-2,3-DIFLUOROBENZENE;BENZENE, 1-ETHOXY-2,3-DIFLUORO-;2,3-Difluorophenyl ethyl ether;2,3-Difluoroethoxybenzene 1-Ethoxy-2,3-difluorobenzene;2,3-Difluorophenetole;2,3-DIFLUOROETHOXYBE | | CAS: | 121219-07-6 | | MF: | C8H8F2O | | MW: | 158.15 | | EINECS: | 441-000-4 | | Product Categories: | Fluorine series;Aromatic Halides (substituted);Anisole | | Mol File: | 121219-07-6.mol |  |
| | 2,3-DIFLUOROETHOXYBENZENE Chemical Properties |
| Boiling point | 178 | | density | 1.1784 | | vapor pressure | 4.13hPa at 20℃ | | refractive index | 1.4670-1.4710 | | Fp | 70.5 | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Light yellow | | Water Solubility | 254mg/L at 20℃ | | InChI | InChI=1S/C8H8F2O/c1-2-11-7-5-3-4-6(9)8(7)10/h3-5H,2H2,1H3 | | InChIKey | AVOGLGBKOFOSBN-UHFFFAOYSA-N | | SMILES | C1(OCC)=CC=CC(F)=C1F | | LogP | 2.82 at 23℃ | | CAS DataBase Reference | 121219-07-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37 | | HS Code | 29093090 |
| | 2,3-DIFLUOROETHOXYBENZENE Usage And Synthesis |
| Chemical Properties | Clear colorless liquid | | Uses | 2,3-Difluoroethoxybenzene is a liquid that can be used as a synthetic intermediate for pharmaceutical molecules and liquid crystal materials.
| | Flammability and Explosibility | Not classified | | Chemical Reactivity |
2,3-Difluoroethoxybenzene is stable under recommended temperatures and pressures, it can reacts with strong oxidizing agents.
|
| | 2,3-DIFLUOROETHOXYBENZENE Preparation Products And Raw materials |
|