|
|
| | 2-Chloro-1,3-dinitrobenzene Basic information |
| Product Name: | 2-Chloro-1,3-dinitrobenzene | | Synonyms: | 1-CHLORO-2,6-DINITROBENZENE;1,3-Dinitro-2-chlorobenzene;2-chloro-1,3-dinitro-benzen;2-Chloro-1,3-dintrobenzene;2,6-Dinitrophenyl chloride;2,6-Dinitro-1-Chlorobenzene;Benzene, 2-chloro-1,3-dinitro-;1-Chloro-2,6-dinitrobenzene~2,6-Dinitrochlorobenzene | | CAS: | 606-21-3 | | MF: | C6H3ClN2O4 | | MW: | 202.55 | | EINECS: | 210-107-6 | | Product Categories: | Intermediates of Dyes and Pigments;Alcohols and Derivatives | | Mol File: | 606-21-3.mol |  |
| | 2-Chloro-1,3-dinitrobenzene Chemical Properties |
| Melting point | 86-88°C | | Boiling point | 315°C | | density | 1,687 g/cm3 | | refractive index | 1.5870 (estimate) | | Fp | 315°C | | storage temp. | 2-8°C | | form | solid | | color | Pale-yellow to Yellow-brown | | Water Solubility | Soluble in alcohol. Moderately soluble in benzene, ether. Practically insoluble in water. | | Merck | 14,2137 | | BRN | 522187 | | InChI | InChI=1S/C6H3ClN2O4/c7-6-4(8(10)11)2-1-3-5(6)9(12)13/h1-3H | | InChIKey | BPPMIQPXQVIZNJ-UHFFFAOYSA-N | | SMILES | C1([N+]([O-])=O)=CC=CC([N+]([O-])=O)=C1Cl | | CAS DataBase Reference | 606-21-3(CAS DataBase Reference) | | NIST Chemistry Reference | 1-Chloro-2,6-dinitrobenzene(606-21-3) | | EPA Substance Registry System | 2,6-Dinitrochlorobenzene (606-21-3) |
| | 2-Chloro-1,3-dinitrobenzene Usage And Synthesis |
| Chemical Properties | Yellow crystals. Soluble in ethanol, ether, and toluene | | Uses | The commercial mixture
of chlorodinitrobenzenes is used to synthesize other
compounds. | | Uses | 2-Chloro-1,3-dinitrobenzene can be used as intermediates of dyes and pigments. Also used as solvents in HPLC, NMR. | | Uses | 2,6-Dinitrochlorobenzene (2-Chloro-1,3-dinitrobenzene) is a thiol-modifying agent. | | Hazard | Toxic if swallowed. Toxic in contact with skin. Fatal if inhaled. May
cause damage to organs through prolonged or repeated exposure. Very
toxic to aquatic life with long lasting effects. | | Synthesis | The synthesis of 2-Chloro-1,3-dinitrobenzene is as follows:
Add 800ml of sulfolane as solvent to a 2L flask, then add 246.5g of 3,5-dinitro-4-chlorobenzoic acid and 168g of sodium bicarbonate,Heat to 195°C to react for 2h. After the reaction is complete, cool to 130°C and distill under reduced pressure.The product 2-Chloro-1,3-dinitrobenzene, 178.4g, was obtained by rectification with a yield of 88.1%.
|
| | 2-Chloro-1,3-dinitrobenzene Preparation Products And Raw materials |
|