|
|
| | METHYL 6-FORMYLNICOTINATE Basic information |
| Product Name: | METHYL 6-FORMYLNICOTINATE | | Synonyms: | METHYL 6-FORMYLNICOTINATE;3-Pyridinecarboxylic acid, 6-forMyl-, Methyl ester;methyl 2-formylpyridine-5-carboxylate;Methyl 6-formylpyridine-3-carboxylate;6-Formylpyridine-3-carboxylic acid methyl ester;METHY 6-FORMYLNICOTINATE;Methyl 6-formylpyridin-3-carboxylate | | CAS: | 10165-86-3 | | MF: | C8H7NO3 | | MW: | 165.15 | | EINECS: | | | Product Categories: | | | Mol File: | 10165-86-3.mol |  |
| | METHYL 6-FORMYLNICOTINATE Chemical Properties |
| Melting point | 115-116.7 °C | | Boiling point | 273℃ | | density | 1.249 | | Fp | 119℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 1.68±0.10(Predicted) | | form | solid | | color | Yellow to brown | | InChI | InChI=1S/C8H7NO3/c1-12-8(11)6-2-3-7(5-10)9-4-6/h2-5H,1H3 | | InChIKey | BZOWIADSJYMJJJ-UHFFFAOYSA-N | | SMILES | C1=NC(C=O)=CC=C1C(OC)=O |
| Hazard Codes | Xi | | Risk Statements | 37/38-41 | | Safety Statements | 26-39-36 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| | METHYL 6-FORMYLNICOTINATE Usage And Synthesis |
| Synthesis Reference(s) | Tetrahedron, 64, p. 688, 2008 DOI: 10.1016/j.tet.2007.11.030 | | Synthesis | General procedure for the synthesis of methyl 6-formylnicotinate from methyl 6-hydroxymethylnicotinate: a mixture of methyl 6-hydroxymethylnicotinate (7 g, 37 mmol) and manganese dioxide (32.3 g, 372 mmol) in dichloromethane (200 mL) was stirred and reacted for 4 hours at 20°C. After completion of the reaction, the mixture was filtered and the filtrate was concentrated. The residue was purified by silica gel column chromatography (petroleum ether/ethyl acetate = 5/1) to afford methyl 6-formylnicotinate (6 g, 97% yield). Mass spectral data: MS-ESI (m/z): 166.2 ([M + H]+) (LC-MS method C; retention time: 0.36 min). | | References | [1] Patent: WO2014/114185, 2014, A1. Location in patent: Page/Page column 126
[2] Patent: US2014/206681, 2014, A1. Location in patent: Paragraph 0782
[3] Molecules, 2014, vol. 19, # 1, p. 102 - 121
[4] Patent: CN104418811, 2017, B. Location in patent: Paragraph 0234-0236
[5] Tetrahedron Letters, 2006, vol. 47, # 39, p. 7025 - 7029 |
| | METHYL 6-FORMYLNICOTINATE Preparation Products And Raw materials |
|