| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
Matrix Scientific |
| Tel: |
803 788-9494 All other calls |
| Email: |
sales@matrixscientific.com |
|
| | 2-(3-Methyl-1,1-dioxo-tetrahydro-1lambda6-thiophen-3-ylamino)-ethanol hydrochloride Basic information |
| | 2-(3-Methyl-1,1-dioxo-tetrahydro-1lambda6-thiophen-3-ylamino)-ethanol hydrochloride Chemical Properties |
| form | solid | | InChI | 1S/C7H15NO3S.ClH/c1-7(8-3-4-9)2-5-12(10,11)6-7;/h8-9H,2-6H2,1H3;1H | | InChIKey | PBFKIWDWQINJAR-UHFFFAOYSA-N | | SMILES | Cl.CC1(CCS(=O)(=O)C1)NCCO |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | 2-(3-Methyl-1,1-dioxo-tetrahydro-1lambda6-thiophen-3-ylamino)-ethanol hydrochloride Usage And Synthesis |
| | 2-(3-Methyl-1,1-dioxo-tetrahydro-1lambda6-thiophen-3-ylamino)-ethanol hydrochloride Preparation Products And Raw materials |
|