- Acetamiprid
-
- $10.00 / 1KG
-
2026-03-20
- CAS:160430-64-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
- Acetamiprid
-
- $15.00 / 1KG
-
2021-07-10
- CAS:160430-64-8
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
- acetamiprid
-
- $1.00 / 1kg
-
2019-07-06
- CAS:160430-64-8
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 100KG
|
| | Acetamiprid Basic information |
| Product Name: | Acetamiprid | | Synonyms: | N-((6-CHLOROPYRIDIN-3-YL)METHYL)-N'-CYANO-N-METHYLACETAMIDINE;MORTAL;MOSPILAN;MOSPILDATE;N-(6-Chloro-3-pyridylmethyl)-N-cyano-N-methylacetamidine;Assail;(E)-N-((6-Chloro-3-pyridinyl)methyl)-N'-cyano-N-methyl-ethanimidamide;(E)-N-(6-CHLORO-3-PYRIDYLMETHYL)-N'-CYANO-N-METHYLACETAMIDINE | | CAS: | 160430-64-8 | | MF: | C10H11ClN4 | | MW: | 222.67 | | EINECS: | | | Product Categories: | Pesticide;INSECTICIDE;Biochemistry agonist | | Mol File: | 160430-64-8.mol |  |
| | Acetamiprid Chemical Properties |
| Melting point | 100-102°C | | storage temp. | 2-8°C | | Major Application | agriculture
environmental | | InChI | InChI=1S/C10H11ClN4/c1-8(14-7-12)15(2)6-9-3-4-10(11)13-5-9/h3-5H,6H2,1-2H3/b14-8+ | | InChIKey | WCXDHFDTOYPNIE-RIYZIHGNSA-N | | SMILES | C(/N(CC1=CC=C(Cl)N=C1)C)(=N\C#N)\C | | LogP | 0.620 (est) | | CAS DataBase Reference | 160430-64-8(CAS DataBase Reference) | | NIST Chemistry Reference | Acetamiprid(160430-64-8) |
| Hazard Codes | T | | Risk Statements | 23/25-57 | | Safety Statements | 45 | | RIDADR | UN 2811 | | WGK Germany | 3 | | RTECS | KJ4235200 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Aquatic Acute 1
Aquatic Chronic 1
Repr. 2 | | Toxicity | LD50 in male, female rats, male, female mice (mg/kg): 217, 146, 198, 184 orally (Takahashi) |
| | Acetamiprid Usage And Synthesis |
| Uses | Insecticide. | | Definition | ChEBI: A carboxamidine that is acetamidine in which the amino hydrogens are substituted by a (6-chloropyridin-3-yl)methyl and a methyl group while the hydrogen attached to the imino nitrogen is replaced by a cyano group. |
| | Acetamiprid Preparation Products And Raw materials |
|