| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Fenthoxon CAS:6552-12-1 Package:100Mg,1g
|
|
| | FENTHION-OXON Basic information |
| | FENTHION-OXON Chemical Properties |
| Boiling point | 108 °C(Press: 0.01 Torr) | | density | 1.22±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | InChI | 1S/C10H15O4PS/c1-8-7-9(5-6-10(8)16-4)14-15(11,12-2)13-3/h5-7H,1-4H3 | | InChIKey | ZNRZGJAHNMGWQN-UHFFFAOYSA-N | | SMILES | O=P(OC1=CC(C)=C(SC)C=C1)(OC)OC |
| RIDADR | 3018 | | WGK Germany | WGK 1 | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | FENTHION-OXON Usage And Synthesis |
| Chemical Properties | Clear Colourless Oil | | Uses | A major metabolite of Fenthion (FEN) |
| | FENTHION-OXON Preparation Products And Raw materials |
|