|
|
| | (S)-2-AMINO-3-(5-CHLORO-1H-INDOL-3-YL)-PROPIONIC ACID Basic information |
| Product Name: | (S)-2-AMINO-3-(5-CHLORO-1H-INDOL-3-YL)-PROPIONIC ACID | | Synonyms: | (S)-2-AMINO-3-(5-CHLORO-1H-INDOL-3-YL)-PROPIONIC ACID;L-5-CHLOROTRYPTOPHAN;5-CHLORO-L-TRYPTOPHAN;L-Tryptophan, 5-chloro-;(S)-2-Amino-3-(5-chloro-1H-indol-3-yl)propanoic acid;(2S)-2-amino-3-(5-chloro-1H-indol-3-yl)propanoic acid;methyl (R)-2-((tert-butoxycarbonyl)amino)-3-(5-chloro-1H-indol-3-yl)propanoate | | CAS: | 52448-15-4 | | MF: | C11H11ClN2O2 | | MW: | 238.67 | | EINECS: | | | Product Categories: | | | Mol File: | 52448-15-4.mol |  |
| | (S)-2-AMINO-3-(5-CHLORO-1H-INDOL-3-YL)-PROPIONIC ACID Chemical Properties |
| Melting point | 272-275 °C | | Boiling point | 476.9±45.0 °C(Predicted) | | density | 1.474±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | Aqueous Acid (Slightly, Sonicated, Heated), Aqueous Base (Slightly) | | form | Solid | | pka | 2.21±0.10(Predicted) | | color | Pale Brown | | Stability: | Hygroscopic | | InChI | InChI=1S/C11H11ClN2O2/c12-7-1-2-10-8(4-7)6(5-14-10)3-9(13)11(15)16/h1-2,4-5,9,14H,3,13H2,(H,15,16)/t9-/m0/s1 | | InChIKey | TUKKZLIDCNWKIN-VIFPVBQESA-N | | SMILES | C(O)(=O)[C@H](CC1C2=C(C=CC(Cl)=C2)NC=1)N |
| | (S)-2-AMINO-3-(5-CHLORO-1H-INDOL-3-YL)-PROPIONIC ACID Usage And Synthesis |
| Definition | ChEBI: 5-chloro-L-tryptophan is a non-proteinogenic L-alpha-amino acid that is L-tryptophan in which the hydrogen at position 5 of the indole ring has been replaced by a chlorine. It is a non-proteinogenic L-alpha-amino acid, an organochlorine compound and a L-tryptophan derivative. It is a tautomer of a 5-chloro-L-tryptophan zwitterion. |
| | (S)-2-AMINO-3-(5-CHLORO-1H-INDOL-3-YL)-PROPIONIC ACID Preparation Products And Raw materials |
|