|
|
| | 4,4'-DIPYRIDYL SULFIDE Basic information |
| Product Name: | 4,4'-DIPYRIDYL SULFIDE | | Synonyms: | 4,4'-DIPYRIDYL SULFIDE;Dipyridylsulfide;4,4''-DIPYRIDYL SULFIDE 97+%;Bis(4-pyridinyl) sulfide;Bis(4-pyridyl) sulfide;Di(4-pyridinyl) sulfide;Di(4-pyridyl) sulfide;4-(4-Pyridinylsulfanyl)pyridine | | CAS: | 37968-97-1 | | MF: | C10H8N2S | | MW: | 188.25 | | EINECS: | | | Product Categories: | | | Mol File: | 37968-97-1.mol |  |
| | 4,4'-DIPYRIDYL SULFIDE Chemical Properties |
| Melting point | 69 °C | | Boiling point | 155 °C(Press: 1.5 Torr) | | density | 1.25±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | form | powder to crystal | | pka | 3.87±0.26(Predicted) | | color | White to Gray to Brown | | InChI | InChI=1S/C10H8N2S/c1-5-11-6-2-9(1)13-10-3-7-12-8-4-10/h1-8H | | InChIKey | XGJOFCCBFCHEHK-UHFFFAOYSA-N | | SMILES | S(C1C=CN=CC=1)C1C=CN=CC=1 |
| Hazard Codes | Xn | | Risk Statements | 22-36-40 | | Safety Statements | 36-26 | | WGK Germany | WGK 3 | | HS Code | 29335990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 4,4'-DIPYRIDYL SULFIDE Usage And Synthesis |
| | 4,4'-DIPYRIDYL SULFIDE Preparation Products And Raw materials |
|