|
|
| | Dimezone S Basic information |
| Product Name: | Dimezone S | | Synonyms: | 4-(Hydroxymethyl)-4-methyl-1-phenyl-3-pyrozolidinone;DimezoneS(4-Hydroxymethyl-4-methyl-1-phenyl-3-pyrazolidone);(4R)-4-(hydroxymethyl)-4-methyl-1-phenyl-3-pyrazolidinone;3-Pyrazolidinone, 4-(hydroxymethyl)-4-methyl-1-phenyl-;4-Hydroxymethyl-4-methyl-1-phenyl-3-pyrazolidon;DIMEZONS;1-Phenyl-4-(hydroxymethyl)-4-methylpyrazolidine-3-one;1-Phenyl-4-methyl-4-(hydroxymethyl)pyrazolidine-3-one | | CAS: | 13047-13-7 | | MF: | C11H14N2O2 | | MW: | 206.24 | | EINECS: | 235-920-3 | | Product Categories: | | | Mol File: | 13047-13-7.mol |  |
| | Dimezone S Chemical Properties |
| Melting point | 122-126 °C | | Boiling point | 345.1°C (rough estimate) | | density | 1.1427 (rough estimate) | | vapor pressure | 0Pa at 25℃ | | refractive index | 1.5700 (estimate) | | Fp | 113 °C | | storage temp. | Storage temp. 2-8°C | | pka | 9.09±0.70(Predicted) | | form | Solid:particulate/powder | | Appearance | Yellow to brown Solid | | Water Solubility | 7.1 g/L (20 ºC) | | InChI | InChI=1S/C11H14N2O2/c1-11(8-14)7-13(12-10(11)15)9-5-3-2-4-6-9/h2-6,14H,7-8H2,1H3,(H,12,15) | | InChIKey | DSVIHYOAKPVFEH-UHFFFAOYSA-N | | SMILES | N1(C2=CC=CC=C2)CC(CO)(C)C(=O)N1 | | LogP | 0.18 | | CAS DataBase Reference | 13047-13-7(CAS DataBase Reference) | | EPA Substance Registry System | 3-Pyrazolidinone, 4-(hydroxymethyl)-4-methyl-1-phenyl- (13047-13-7) |
| | Dimezone S Usage And Synthesis |
| Chemical Properties | cream to yellow crystalline powder |
| | Dimezone S Preparation Products And Raw materials |
|