| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
EvoBlocks, Ltd.
|
| Tel: |
+36 (20) 5757-305 |
| Email: |
sales@evoblocks.com |
|
| | 5-oxo-1-[3-(propan-2-yloxy)propyl]pyrrolidine-3-carboxylic acid Basic information |
| | 5-oxo-1-[3-(propan-2-yloxy)propyl]pyrrolidine-3-carboxylic acid Chemical Properties |
| Boiling point | 419.7±40.0 °C(Predicted) | | density | 1.152±0.06 g/cm3(Predicted) | | form | powder | | pka | 4.53±0.20(Predicted) | | InChI | 1S/C11H19NO4/c1-8(2)16-5-3-4-12-7-9(11(14)15)6-10(12)13/h8-9H,3-7H2,1-2H3,(H,14,15) | | InChIKey | PDOABIJVALUASF-UHFFFAOYSA-N | | SMILES | O=C1CC(C(O)=O)CN1CCCOC(C)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 5-oxo-1-[3-(propan-2-yloxy)propyl]pyrrolidine-3-carboxylic acid Usage And Synthesis |
| | 5-oxo-1-[3-(propan-2-yloxy)propyl]pyrrolidine-3-carboxylic acid Preparation Products And Raw materials |
|