|
|
| | 4-(4-Fluorophenyl)-6-isopropyl-2-[(N-methyl-N-methylsulfonyl)amino]pyrimidinyl-5-yl-formyl Basic information |
| | 4-(4-Fluorophenyl)-6-isopropyl-2-[(N-methyl-N-methylsulfonyl)amino]pyrimidinyl-5-yl-formyl Chemical Properties |
| Melting point | 178.0 to 182.0 °C | | Boiling point | 536.6±60.0 °C(Predicted) | | density | 1.320±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | solubility | DMSO (Slightly), Methanol (Very Slightly, Heated) | | form | Solid | | pka | -1.68±0.10(Predicted) | | color | White | | InChI | InChI=1S/C16H18FN3O3S/c1-10(2)14-13(9-21)15(11-5-7-12(17)8-6-11)19-16(18-14)20(3)24(4,22)23/h5-10H,1-4H3 | | InChIKey | WOCOTUDOVSLFOB-UHFFFAOYSA-N | | SMILES | CS(N(C1=NC(C(C)C)=C(C=O)C(C2=CC=C(F)C=C2)=N1)C)(=O)=O | | CAS DataBase Reference | 147118-37-4(CAS DataBase Reference) |
| | 4-(4-Fluorophenyl)-6-isopropyl-2-[(N-methyl-N-methylsulfonyl)amino]pyrimidinyl-5-yl-formyl Usage And Synthesis |
| Uses | Rosuvastatin intermediate. |
| | 4-(4-Fluorophenyl)-6-isopropyl-2-[(N-methyl-N-methylsulfonyl)amino]pyrimidinyl-5-yl-formyl Preparation Products And Raw materials |
|