Boc-3-(2-thienyl)-L-alanine manufacturers
|
| | Boc-3-(2-thienyl)-L-alanine Basic information |
| | Boc-3-(2-thienyl)-L-alanine Chemical Properties |
| Melting point | 71-76 °C | | alpha | 11 º (c=1% in MeOH) | | density | 1.2791 (rough estimate) | | refractive index | 1.6280 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,2-8°C | | form | Solid | | color | White to off-white | | Optical Rotation | [α]20/D +11.0±2°, c = 1% in methanol | | BRN | 1388299 | | Major Application | peptide synthesis | | InChI | InChI=1/C12H17NO4S/c1-12(2,3)17-11(16)13-9(10(14)15)7-8-5-4-6-18-8/h4-6,9H,7H2,1-3H3,(H,13,16)(H,14,15)/t9-/s3 | | InChIKey | OJLISTAWQHSIHL-DJEYLCQNNA-N | | SMILES | [C@H](C(=O)O)(NC(=O)OC(C)(C)C)CC1SC=CC=1 |&1:0,r| | | CAS DataBase Reference | 56675-37-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids |
| | Boc-3-(2-thienyl)-L-alanine Usage And Synthesis |
| Chemical Properties | White to off-white crystalline powder | | Uses | Boc-β-(2-thienyl)-Ala-OH may be used in chemical synthesis studies. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-3-(2-thienyl)-L-alanine Preparation Products And Raw materials |
|