- 5-TERT-BUTYL-M-XYLENE
-
- $1.00 / 1KG
-
2026-01-30
- CAS:98-19-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
- 5-TERT-BUTYL-M-XYLENE
-
- $1.70 / 1kg
-
2025-05-26
- CAS:98-19-1
- Min. Order: 10kg
- Purity: 99%
- Supply Ability: 10000kg
|
| | 1-tert-Butyl-3,5-dimethylbenzene Basic information |
| Product Name: | 1-tert-Butyl-3,5-dimethylbenzene | | Synonyms: | Xylometazoline EP Impurity D;5-TERT-BUTYL-M-XYLENE;1,3-DIMETHYL-5-TERT-BUTYLBENZENE;1-(1,1-dimethylethyl)-3,5-dimethyl-benzen;1-(1,1-Dimethylethyl)-3,5-dimethylbenzene;1-(1,1-dimethylethyl)-3,5-dimethyl-Benzene;1-TERT-BUTYL-3,5-DIMETHYLBENZENE;SYM-TERT-BUTYL-M-XYLENE | | CAS: | 98-19-1 | | MF: | C12H18 | | MW: | 162.27 | | EINECS: | 202-647-6 | | Product Categories: | | | Mol File: | 98-19-1.mol |  |
| | 1-tert-Butyl-3,5-dimethylbenzene Chemical Properties |
| Melting point | -18 °C | | Boiling point | 205-206 °C(lit.) | | density | 0.867 g/mL at 25 °C(lit.) | | vapor pressure | 0.4 hPa (20 °C) | | refractive index | n20/D 1.495(lit.) | | Fp | 162 °F | | storage temp. | Store below +30°C. | | form | clear liquid | | color | Colorless to Almost colorless | | PH | 7 (H2O, 20℃) | | BRN | 1853314 | | InChI | InChI=1S/C12H18/c1-9-6-10(2)8-11(7-9)12(3,4)5/h6-8H,1-5H3 | | InChIKey | FZSPYHREEHYLCB-UHFFFAOYSA-N | | SMILES | C1(C(C)(C)C)=CC(C)=CC(C)=C1 | | CAS DataBase Reference | 98-19-1(CAS DataBase Reference) | | EPA Substance Registry System | 5-tert-Butyl-m-xylene (98-19-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | ZE3900000 | | Autoignition Temperature | 560 °C DIN 51794 | | TSCA | TSCA listed | | HS Code | 2902 90 00 | | Storage Class | 10 - Combustible liquids |
| | 1-tert-Butyl-3,5-dimethylbenzene Usage And Synthesis |
| Chemical Properties | clear colourless to slightly yellow liquid | | Uses | 1-tert-Butyl-3,5-dimethylbenzene has been used in the synthesis of bulky, multi-alkylated diaryl disulfides such as bis(4-tert-butyl-2,6-dimethylphenyl) disulfide and bis(2,4,6-triisopropylphenyl) disulfide. | | General Description | 1-tert-Butyl-3,5-dimethylbenzene participates in the cascade diarylation of N-phenylacetamides with non-prefunctionalized arenes. |
| | 1-tert-Butyl-3,5-dimethylbenzene Preparation Products And Raw materials |
|