|
|
| | 3-[(1S)-1-(Dimethylaminoethyl)]phenol Basic information |
| | 3-[(1S)-1-(Dimethylaminoethyl)]phenol Chemical Properties |
| Melting point | 87-88°C | | Boiling point | 241℃ | | density | 1.021 | | Fp | 97℃ | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 9.86±0.10(Predicted) | | form | Solid | | color | White to Off-White | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C10H15NO/c1-8(11(2)3)9-5-4-6-10(12)7-9/h4-8,12H,1-3H3/t8-/m0/s1 | | InChIKey | GQZXRLWUYONVCP-QMMMGPOBSA-N | | SMILES | C1(O)=CC=CC([C@@H](N(C)C)C)=C1 | | CAS DataBase Reference | 139306-10-8(CAS DataBase Reference) |
| Risk Statements | 36-43 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | HS Code | 29222990 | | Storage Class | 11 - Combustible Solids |
| | 3-[(1S)-1-(Dimethylaminoethyl)]phenol Usage And Synthesis |
| Description | NAP 226-90 is a metabolite of rivastigmine that is formed by hydrolysis. | | Chemical Properties | off-white to pale yellow crysta | | Uses | NAP 226-90 (Rivastigmine EP Impurity A; Rivastigmin USP Related Compound C) is a S-Enantiomer metabolite of Rivastigmine, a brain selective acetylcholinesterase inhibitor. | | References | [1] MD R J P. Clinical pharmacology of rivastigmine: a new-generation acetylcholinesterase inhibitor for the treatment of alzheimer’s disease[J]. Clinical therapeutics, 1998, 20 4: Pages 634-647. DOI: 10.1016/s0149-2918(98)80127-6 |
| | 3-[(1S)-1-(Dimethylaminoethyl)]phenol Preparation Products And Raw materials |
|